From b8d4ea2b3dc6347d0fc3636e9a9082fcd408cd4e Mon Sep 17 00:00:00 2001 From: jared Date: Tue, 27 Jan 2026 15:00:34 -0500 Subject: [PATCH] api backend --- news-app/.gitignore | 30 + news-app/How_To_MacOS.txt | 80 + news-app/build/assets/index-BcP3wp7F.css | 1 + news-app/build/assets/index-BvWUS-em.js | 190 ++ news-app/build/index.html | 14 + news-app/build/vite.svg | 1 + news-app/com.je.carnews.plist | 34 + news-app/for_ubuntu.txt | 62 + news-app/index.html | 13 + news-app/package-lock.json | 3289 ++++++++++++++++++++++ news-app/package.json | 27 + news-app/public/vite.svg | 1 + news-app/server.js | 324 +++ news-app/src/counter.js | 9 + news-app/src/javascript.svg | 1 + news-app/src/main.js | 539 ++++ news-app/src/style.css | 118 + news-app/vite.config.js | 15 + 18 files changed, 4748 insertions(+) create mode 100644 news-app/.gitignore create mode 100644 news-app/How_To_MacOS.txt create mode 100644 news-app/build/assets/index-BcP3wp7F.css create mode 100644 news-app/build/assets/index-BvWUS-em.js create mode 100644 news-app/build/index.html create mode 100644 news-app/build/vite.svg create mode 100644 news-app/com.je.carnews.plist create mode 100644 news-app/for_ubuntu.txt create mode 100644 news-app/index.html create mode 100644 news-app/package-lock.json create mode 100644 news-app/package.json create mode 100644 news-app/public/vite.svg create mode 100644 news-app/server.js create mode 100644 news-app/src/counter.js create mode 100644 news-app/src/javascript.svg create mode 100644 news-app/src/main.js create mode 100644 news-app/src/style.css create mode 100644 news-app/vite.config.js diff --git a/news-app/.gitignore b/news-app/.gitignore new file mode 100644 index 0000000..6f05e5e --- /dev/null +++ b/news-app/.gitignore @@ -0,0 +1,30 @@ +# Environment variables +.env + +# SQLite cache +cache.db + +# Logs +logs +*.log +npm-debug.log* +yarn-debug.log* +yarn-error.log* +pnpm-debug.log* +lerna-debug.log* + +node_modules +dist +dist-ssr +*.local + +# Editor directories and files +.vscode/* +!.vscode/extensions.json +.idea +.DS_Store +*.suo +*.ntvs* +*.njsproj +*.sln +*.sw? diff --git a/news-app/How_To_MacOS.txt b/news-app/How_To_MacOS.txt new file mode 100644 index 0000000..d4a2969 --- /dev/null +++ b/news-app/How_To_MacOS.txt @@ -0,0 +1,80 @@ +News App - macOS Service Management +==================================== + +Service: com.je.carnews +Port: 5555 +Plist: /Library/LaunchDaemons/com.je.carnews.plist + + +BASIC COMMANDS +-------------- + +Start the service: + sudo launchctl kickstart system/com.je.carnews + +Stop the service: + sudo launchctl kill SIGTERM system/com.je.carnews + +Restart the service: + sudo launchctl kickstart -k system/com.je.carnews + +Check status: + sudo launchctl print system/com.je.carnews + +Check if running: + lsof -i :5555 + + +ADD TO STARTUP (BOOT) +--------------------- + +1. Copy the plist to LaunchDaemons: + sudo cp /opt/homebrew/var/www/news-app/com.je.carnews.plist /Library/LaunchDaemons/ + +2. Load the service: + sudo launchctl bootstrap system /Library/LaunchDaemons/com.je.carnews.plist + +3. Start it: + sudo launchctl kickstart system/com.je.carnews + +The service will now start automatically on boot. + + +REMOVE FROM STARTUP (BOOT) +-------------------------- + +1. Stop and unload the service: + sudo launchctl bootout system/com.je.carnews + +2. Remove the plist file: + sudo rm /Library/LaunchDaemons/com.je.carnews.plist + +The service will no longer start on boot. + + +VIEW LOGS +--------- + +Output log: + tail -f /opt/homebrew/var/www/news-app/logs/out.log + +Error log: + tail -f /opt/homebrew/var/www/news-app/logs/error.log + + +TROUBLESHOOTING +--------------- + +If the service fails to start, check: + +1. Node version - the plist uses: + /Users/jared/.nvm/versions/node/v22.19.0/bin/node + +2. If you update Node via nvm, rebuild native modules: + cd /opt/homebrew/var/www/news-app + npm rebuild better-sqlite3 + +3. Then update the node path in the plist if needed and reload: + sudo launchctl bootout system/com.je.carnews + sudo launchctl bootstrap system /Library/LaunchDaemons/com.je.carnews.plist + sudo launchctl kickstart system/com.je.carnews diff --git a/news-app/build/assets/index-BcP3wp7F.css b/news-app/build/assets/index-BcP3wp7F.css new file mode 100644 index 0000000..78ba6ea --- /dev/null +++ b/news-app/build/assets/index-BcP3wp7F.css @@ -0,0 +1 @@ +@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-translate-x:0;--tw-translate-y:0;--tw-translate-z:0;--tw-space-y-reverse:0;--tw-border-style:solid;--tw-gradient-position:initial;--tw-gradient-from:#0000;--tw-gradient-via:#0000;--tw-gradient-to:#0000;--tw-gradient-stops:initial;--tw-gradient-via-stops:initial;--tw-gradient-from-position:0%;--tw-gradient-via-position:50%;--tw-gradient-to-position:100%;--tw-leading:initial;--tw-font-weight:initial;--tw-shadow:0 0 #0000;--tw-shadow-color:initial;--tw-shadow-alpha:100%;--tw-inset-shadow:0 0 #0000;--tw-inset-shadow-color:initial;--tw-inset-shadow-alpha:100%;--tw-ring-color:initial;--tw-ring-shadow:0 0 #0000;--tw-inset-ring-color:initial;--tw-inset-ring-shadow:0 0 #0000;--tw-ring-inset:initial;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-offset-shadow:0 0 #0000;--tw-blur:initial;--tw-brightness:initial;--tw-contrast:initial;--tw-grayscale:initial;--tw-hue-rotate:initial;--tw-invert:initial;--tw-opacity:initial;--tw-saturate:initial;--tw-sepia:initial;--tw-drop-shadow:initial;--tw-drop-shadow-color:initial;--tw-drop-shadow-alpha:100%;--tw-drop-shadow-size:initial;--tw-backdrop-blur:initial;--tw-backdrop-brightness:initial;--tw-backdrop-contrast:initial;--tw-backdrop-grayscale:initial;--tw-backdrop-hue-rotate:initial;--tw-backdrop-invert:initial;--tw-backdrop-opacity:initial;--tw-backdrop-saturate:initial;--tw-backdrop-sepia:initial;--tw-duration:initial;--tw-scale-x:1;--tw-scale-y:1;--tw-scale-z:1}}}@layer theme{:root,:host{--font-sans:ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-mono:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--color-red-50:oklch(97.1% .013 17.38);--color-red-100:oklch(93.6% .032 17.717);--color-red-600:oklch(57.7% .245 27.325);--color-red-800:oklch(44.4% .177 26.899);--color-orange-100:oklch(95.4% .038 75.164);--color-orange-800:oklch(47% .157 37.304);--color-green-100:oklch(96.2% .044 156.743);--color-green-800:oklch(44.8% .119 151.328);--color-emerald-100:oklch(95% .052 163.051);--color-emerald-800:oklch(43.2% .095 166.913);--color-teal-100:oklch(95.3% .051 180.801);--color-teal-800:oklch(43.7% .078 188.216);--color-blue-100:oklch(93.2% .032 255.585);--color-blue-200:oklch(88.2% .059 254.128);--color-blue-500:oklch(62.3% .214 259.815);--color-blue-600:oklch(54.6% .245 262.881);--color-blue-700:oklch(48.8% .243 264.376);--color-blue-800:oklch(42.4% .199 265.638);--color-indigo-100:oklch(93% .034 272.788);--color-indigo-200:oklch(87% .065 274.039);--color-indigo-700:oklch(45.7% .24 277.023);--color-indigo-800:oklch(39.8% .195 277.366);--color-purple-100:oklch(94.6% .033 307.174);--color-purple-800:oklch(43.8% .218 303.724);--color-pink-100:oklch(94.8% .028 342.258);--color-pink-800:oklch(45.9% .187 3.815);--color-slate-100:oklch(96.8% .007 247.896);--color-slate-800:oklch(27.9% .041 260.031);--color-gray-50:oklch(98.5% .002 247.839);--color-gray-100:oklch(96.7% .003 264.542);--color-gray-200:oklch(92.8% .006 264.531);--color-gray-300:oklch(87.2% .01 258.338);--color-gray-400:oklch(70.7% .022 261.325);--color-gray-500:oklch(55.1% .027 264.364);--color-gray-600:oklch(44.6% .03 256.802);--color-gray-700:oklch(37.3% .034 259.733);--color-gray-800:oklch(27.8% .033 256.848);--color-gray-900:oklch(21% .034 264.665);--color-white:#fff;--spacing:.25rem;--container-4xl:56rem;--container-7xl:80rem;--text-xs:.75rem;--text-xs--line-height:calc(1/.75);--text-sm:.875rem;--text-sm--line-height:calc(1.25/.875);--text-lg:1.125rem;--text-lg--line-height:calc(1.75/1.125);--text-xl:1.25rem;--text-xl--line-height:calc(1.75/1.25);--text-2xl:1.5rem;--text-2xl--line-height:calc(2/1.5);--text-3xl:1.875rem;--text-3xl--line-height: 1.2 ;--font-weight-medium:500;--font-weight-semibold:600;--font-weight-bold:700;--leading-tight:1.25;--leading-relaxed:1.625;--radius-md:.375rem;--radius-lg:.5rem;--radius-xl:.75rem;--radius-3xl:1.5rem;--animate-spin:spin 1s linear infinite;--blur-sm:8px;--aspect-video:16/9;--default-transition-duration:.15s;--default-transition-timing-function:cubic-bezier(.4,0,.2,1);--default-font-family:var(--font-sans);--default-mono-font-family:var(--font-mono)}}@layer base{*,:after,:before,::backdrop{box-sizing:border-box;border:0 solid;margin:0;padding:0}::file-selector-button{box-sizing:border-box;border:0 solid;margin:0;padding:0}html,:host{-webkit-text-size-adjust:100%;tab-size:4;line-height:1.5;font-family:var(--default-font-family,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji");font-feature-settings:var(--default-font-feature-settings,normal);font-variation-settings:var(--default-font-variation-settings,normal);-webkit-tap-highlight-color:transparent}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;-webkit-text-decoration:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:var(--default-mono-font-family,ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace);font-feature-settings:var(--default-mono-font-feature-settings,normal);font-variation-settings:var(--default-mono-font-variation-settings,normal);font-size:1em}small{font-size:80%}sub,sup{vertical-align:baseline;font-size:75%;line-height:0;position:relative}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}:-moz-focusring{outline:auto}progress{vertical-align:baseline}summary{display:list-item}ol,ul,menu{list-style:none}img,svg,video,canvas,audio,iframe,embed,object{vertical-align:middle;display:block}img,video{max-width:100%;height:auto}button,input,select,optgroup,textarea{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}::file-selector-button{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}:where(select:is([multiple],[size])) optgroup{font-weight:bolder}:where(select:is([multiple],[size])) optgroup option{padding-inline-start:20px}::file-selector-button{margin-inline-end:4px}::placeholder{opacity:1}@supports (not ((-webkit-appearance:-apple-pay-button))) or (contain-intrinsic-size:1px){::placeholder{color:currentColor}@supports (color:color-mix(in lab,red,red)){::placeholder{color:color-mix(in oklab,currentcolor 50%,transparent)}}}textarea{resize:vertical}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-date-and-time-value{min-height:1lh;text-align:inherit}::-webkit-datetime-edit{display:inline-flex}::-webkit-datetime-edit-fields-wrapper{padding:0}::-webkit-datetime-edit{padding-block:0}::-webkit-datetime-edit-year-field{padding-block:0}::-webkit-datetime-edit-month-field{padding-block:0}::-webkit-datetime-edit-day-field{padding-block:0}::-webkit-datetime-edit-hour-field{padding-block:0}::-webkit-datetime-edit-minute-field{padding-block:0}::-webkit-datetime-edit-second-field{padding-block:0}::-webkit-datetime-edit-millisecond-field{padding-block:0}::-webkit-datetime-edit-meridiem-field{padding-block:0}::-webkit-calendar-picker-indicator{line-height:1}:-moz-ui-invalid{box-shadow:none}button,input:where([type=button],[type=reset],[type=submit]){appearance:button}::file-selector-button{appearance:button}::-webkit-inner-spin-button{height:auto}::-webkit-outer-spin-button{height:auto}[hidden]:where(:not([hidden=until-found])){display:none!important}}@layer components;@layer utilities{.absolute{position:absolute}.fixed{position:fixed}.relative{position:relative}.sticky{position:sticky}.inset-0{inset:calc(var(--spacing)*0)}.top-0{top:calc(var(--spacing)*0)}.top-1\/2{top:50%}.top-6{top:calc(var(--spacing)*6)}.right-6{right:calc(var(--spacing)*6)}.bottom-8{bottom:calc(var(--spacing)*8)}.left-1\/2{left:50%}.left-6{left:calc(var(--spacing)*6)}.z-10{z-index:10}.z-20{z-index:20}.z-50{z-index:50}.col-span-full{grid-column:1/-1}.mx-auto{margin-inline:auto}.mt-2{margin-top:calc(var(--spacing)*2)}.mt-auto{margin-top:auto}.mr-2{margin-right:calc(var(--spacing)*2)}.mb-2{margin-bottom:calc(var(--spacing)*2)}.mb-3{margin-bottom:calc(var(--spacing)*3)}.mb-4{margin-bottom:calc(var(--spacing)*4)}.mb-6{margin-bottom:calc(var(--spacing)*6)}.ml-2{margin-left:calc(var(--spacing)*2)}.ml-auto{margin-left:auto}.line-clamp-2{-webkit-line-clamp:2;-webkit-box-orient:vertical;display:-webkit-box;overflow:hidden}.line-clamp-6{-webkit-line-clamp:6;-webkit-box-orient:vertical;display:-webkit-box;overflow:hidden}.line-clamp-\[10\]{-webkit-line-clamp:10;-webkit-box-orient:vertical;display:-webkit-box;overflow:hidden}.block{display:block}.flex{display:flex}.grid{display:grid}.aspect-video{aspect-ratio:var(--aspect-video)}.h-1{height:calc(var(--spacing)*1)}.h-2{height:calc(var(--spacing)*2)}.h-4{height:calc(var(--spacing)*4)}.h-5{height:calc(var(--spacing)*5)}.h-6{height:calc(var(--spacing)*6)}.h-8{height:calc(var(--spacing)*8)}.h-10{height:calc(var(--spacing)*10)}.h-12{height:calc(var(--spacing)*12)}.h-16{height:calc(var(--spacing)*16)}.h-64{height:calc(var(--spacing)*64)}.h-full{height:100%}.min-h-screen{min-height:100vh}.w-2{width:calc(var(--spacing)*2)}.w-4{width:calc(var(--spacing)*4)}.w-5{width:calc(var(--spacing)*5)}.w-6{width:calc(var(--spacing)*6)}.w-8{width:calc(var(--spacing)*8)}.w-10{width:calc(var(--spacing)*10)}.w-12{width:calc(var(--spacing)*12)}.w-16{width:calc(var(--spacing)*16)}.w-full{width:100%}.max-w-4xl{max-width:var(--container-4xl)}.max-w-7xl{max-width:var(--container-7xl)}.-translate-x-1\/2{--tw-translate-x: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y)}.-translate-y-1\/2{--tw-translate-y: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y)}.animate-spin{animation:var(--animate-spin)}.cursor-pointer{cursor:pointer}.grid-cols-1{grid-template-columns:repeat(1,minmax(0,1fr))}.flex-col{flex-direction:column}.flex-wrap{flex-wrap:wrap}.items-center{align-items:center}.justify-center{justify-content:center}.gap-1{gap:calc(var(--spacing)*1)}.gap-1\.5{gap:calc(var(--spacing)*1.5)}.gap-2{gap:calc(var(--spacing)*2)}.gap-3{gap:calc(var(--spacing)*3)}.gap-4{gap:calc(var(--spacing)*4)}.gap-6{gap:calc(var(--spacing)*6)}:where(.space-y-1>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*1)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*1)*calc(1 - var(--tw-space-y-reverse)))}.overflow-hidden{overflow:hidden}.rounded-3xl{border-radius:var(--radius-3xl)}.rounded-full{border-radius:3.40282e38px}.rounded-lg{border-radius:var(--radius-lg)}.rounded-md{border-radius:var(--radius-md)}.rounded-xl{border-radius:var(--radius-xl)}.border{border-style:var(--tw-border-style);border-width:1px}.border-4{border-style:var(--tw-border-style);border-width:4px}.border-t{border-top-style:var(--tw-border-style);border-top-width:1px}.border-l-4{border-left-style:var(--tw-border-style);border-left-width:4px}.border-blue-200{border-color:var(--color-blue-200)}.border-gray-100{border-color:var(--color-gray-100)}.border-gray-200{border-color:var(--color-gray-200)}.border-white\/30{border-color:#ffffff4d}@supports (color:color-mix(in lab,red,red)){.border-white\/30{border-color:color-mix(in oklab,var(--color-white)30%,transparent)}}.border-t-blue-600{border-top-color:var(--color-blue-600)}.border-t-white{border-top-color:var(--color-white)}.border-l-blue-500{border-left-color:var(--color-blue-500)}.bg-blue-100{background-color:var(--color-blue-100)}.bg-blue-600{background-color:var(--color-blue-600)}.bg-emerald-100{background-color:var(--color-emerald-100)}.bg-gray-100{background-color:var(--color-gray-100)}.bg-gray-200{background-color:var(--color-gray-200)}.bg-gray-900{background-color:var(--color-gray-900)}.bg-green-100{background-color:var(--color-green-100)}.bg-indigo-100{background-color:var(--color-indigo-100)}.bg-orange-100{background-color:var(--color-orange-100)}.bg-pink-100{background-color:var(--color-pink-100)}.bg-purple-100{background-color:var(--color-purple-100)}.bg-red-100{background-color:var(--color-red-100)}.bg-slate-100{background-color:var(--color-slate-100)}.bg-teal-100{background-color:var(--color-teal-100)}.bg-white{background-color:var(--color-white)}.bg-white\/40{background-color:#fff6}@supports (color:color-mix(in lab,red,red)){.bg-white\/40{background-color:color-mix(in oklab,var(--color-white)40%,transparent)}}.bg-white\/95{background-color:#fffffff2}@supports (color:color-mix(in lab,red,red)){.bg-white\/95{background-color:color-mix(in oklab,var(--color-white)95%,transparent)}}.bg-gradient-to-br{--tw-gradient-position:to bottom right in oklab;background-image:linear-gradient(var(--tw-gradient-stops))}.from-gray-50{--tw-gradient-from:var(--color-gray-50);--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position))}.to-gray-100{--tw-gradient-to:var(--color-gray-100);--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position))}.object-cover{object-fit:cover}.p-1{padding:calc(var(--spacing)*1)}.p-2{padding:calc(var(--spacing)*2)}.p-3{padding:calc(var(--spacing)*3)}.p-5{padding:calc(var(--spacing)*5)}.p-6{padding:calc(var(--spacing)*6)}.p-8{padding:calc(var(--spacing)*8)}.px-2{padding-inline:calc(var(--spacing)*2)}.px-2\.5{padding-inline:calc(var(--spacing)*2.5)}.px-3{padding-inline:calc(var(--spacing)*3)}.px-4{padding-inline:calc(var(--spacing)*4)}.py-0\.5{padding-block:calc(var(--spacing)*.5)}.py-1{padding-block:calc(var(--spacing)*1)}.py-1\.5{padding-block:calc(var(--spacing)*1.5)}.py-2{padding-block:calc(var(--spacing)*2)}.py-4{padding-block:calc(var(--spacing)*4)}.py-6{padding-block:calc(var(--spacing)*6)}.py-8{padding-block:calc(var(--spacing)*8)}.py-20{padding-block:calc(var(--spacing)*20)}.pl-4{padding-left:calc(var(--spacing)*4)}.text-center{text-align:center}.text-2xl{font-size:var(--text-2xl);line-height:var(--tw-leading,var(--text-2xl--line-height))}.text-lg{font-size:var(--text-lg);line-height:var(--tw-leading,var(--text-lg--line-height))}.text-sm{font-size:var(--text-sm);line-height:var(--tw-leading,var(--text-sm--line-height))}.text-xl{font-size:var(--text-xl);line-height:var(--tw-leading,var(--text-xl--line-height))}.text-xs{font-size:var(--text-xs);line-height:var(--tw-leading,var(--text-xs--line-height))}.leading-relaxed{--tw-leading:var(--leading-relaxed);line-height:var(--leading-relaxed)}.leading-tight{--tw-leading:var(--leading-tight);line-height:var(--leading-tight)}.font-bold{--tw-font-weight:var(--font-weight-bold);font-weight:var(--font-weight-bold)}.font-medium{--tw-font-weight:var(--font-weight-medium);font-weight:var(--font-weight-medium)}.font-semibold{--tw-font-weight:var(--font-weight-semibold);font-weight:var(--font-weight-semibold)}.text-blue-600{color:var(--color-blue-600)}.text-blue-700{color:var(--color-blue-700)}.text-blue-800{color:var(--color-blue-800)}.text-emerald-800{color:var(--color-emerald-800)}.text-gray-300{color:var(--color-gray-300)}.text-gray-400{color:var(--color-gray-400)}.text-gray-500{color:var(--color-gray-500)}.text-gray-600{color:var(--color-gray-600)}.text-gray-700{color:var(--color-gray-700)}.text-gray-800{color:var(--color-gray-800)}.text-gray-900{color:var(--color-gray-900)}.text-green-800{color:var(--color-green-800)}.text-indigo-700{color:var(--color-indigo-700)}.text-indigo-800{color:var(--color-indigo-800)}.text-orange-800{color:var(--color-orange-800)}.text-pink-800{color:var(--color-pink-800)}.text-purple-800{color:var(--color-purple-800)}.text-red-600{color:var(--color-red-600)}.text-red-800{color:var(--color-red-800)}.text-slate-800{color:var(--color-slate-800)}.text-teal-800{color:var(--color-teal-800)}.text-white{color:var(--color-white)}.text-white\/70{color:#ffffffb3}@supports (color:color-mix(in lab,red,red)){.text-white\/70{color:color-mix(in oklab,var(--color-white)70%,transparent)}}.antialiased{-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.shadow-2xl{--tw-shadow:0 25px 50px -12px var(--tw-shadow-color,#00000040);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.shadow-sm{--tw-shadow:0 1px 3px 0 var(--tw-shadow-color,#0000001a),0 1px 2px -1px var(--tw-shadow-color,#0000001a);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.filter{filter:var(--tw-blur,)var(--tw-brightness,)var(--tw-contrast,)var(--tw-grayscale,)var(--tw-hue-rotate,)var(--tw-invert,)var(--tw-saturate,)var(--tw-sepia,)var(--tw-drop-shadow,)}.backdrop-blur-sm{--tw-backdrop-blur:blur(var(--blur-sm));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,)}.transition-all{transition-property:all;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-colors{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-transform{transition-property:transform,translate,scale,rotate;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.duration-300{--tw-duration:.3s;transition-duration:.3s}@media(hover:hover){.group-hover\:scale-105:is(:where(.group):hover *){--tw-scale-x:105%;--tw-scale-y:105%;--tw-scale-z:105%;scale:var(--tw-scale-x)var(--tw-scale-y)}.group-hover\:text-blue-600:is(:where(.group):hover *){color:var(--color-blue-600)}.hover\:bg-blue-200:hover{background-color:var(--color-blue-200)}.hover\:bg-blue-700:hover{background-color:var(--color-blue-700)}.hover\:bg-gray-100:hover{background-color:var(--color-gray-100)}.hover\:bg-gray-200:hover{background-color:var(--color-gray-200)}.hover\:bg-indigo-200:hover{background-color:var(--color-indigo-200)}.hover\:bg-red-50:hover{background-color:var(--color-red-50)}.hover\:bg-white\/10:hover{background-color:#ffffff1a}@supports (color:color-mix(in lab,red,red)){.hover\:bg-white\/10:hover{background-color:color-mix(in oklab,var(--color-white)10%,transparent)}}.hover\:text-blue-600:hover{color:var(--color-blue-600)}.hover\:text-blue-800:hover{color:var(--color-blue-800)}.hover\:text-gray-700:hover{color:var(--color-gray-700)}.hover\:text-red-800:hover{color:var(--color-red-800)}.hover\:text-white:hover{color:var(--color-white)}.hover\:underline:hover{text-decoration-line:underline}.hover\:shadow-lg:hover{--tw-shadow:0 10px 15px -3px var(--tw-shadow-color,#0000001a),0 4px 6px -4px var(--tw-shadow-color,#0000001a);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}}@media(min-width:40rem){.sm\:h-80{height:calc(var(--spacing)*80)}.sm\:flex-row{flex-direction:row}.sm\:items-center{align-items:center}.sm\:justify-between{justify-content:space-between}.sm\:p-10{padding:calc(var(--spacing)*10)}.sm\:px-6{padding-inline:calc(var(--spacing)*6)}.sm\:text-3xl{font-size:var(--text-3xl);line-height:var(--tw-leading,var(--text-3xl--line-height))}}@media(min-width:48rem){.md\:grid-cols-2{grid-template-columns:repeat(2,minmax(0,1fr))}}@media(min-width:64rem){.lg\:grid-cols-3{grid-template-columns:repeat(3,minmax(0,1fr))}.lg\:px-8{padding-inline:calc(var(--spacing)*8)}}}.car-mode-bg{background:linear-gradient(135deg,#1a1a2e,#16213e,#0f3460);position:relative;overflow:hidden}.car-mode-bg:before,.car-mode-bg:after{content:"";filter:blur(80px);opacity:.4;border-radius:50%;animation:20s ease-in-out infinite float;position:absolute}.car-mode-bg:before{background:linear-gradient(135deg,#667eea,#764ba2);width:600px;height:600px;animation-delay:0s;top:-200px;left:-200px}.car-mode-bg:after{background:linear-gradient(135deg,#f093fb,#f5576c);width:500px;height:500px;animation-delay:-10s;bottom:-150px;right:-150px}.car-mode-blur-1,.car-mode-blur-2,.car-mode-blur-3{filter:blur(100px);opacity:.3;border-radius:50%;animation:25s ease-in-out infinite float;position:absolute}.car-mode-blur-1{background:linear-gradient(135deg,#4facfe,#00f2fe);width:400px;height:400px;animation-delay:-5s;top:50%;left:20%}.car-mode-blur-2{background:linear-gradient(135deg,#43e97b,#38f9d7);width:350px;height:350px;animation-delay:-15s;top:30%;right:10%}.car-mode-blur-3{background:linear-gradient(135deg,#fa709a,#fee140);width:300px;height:300px;animation-delay:-8s;bottom:20%;left:50%}@keyframes float{0%,to{transform:translate(0)scale(1)}25%{transform:translate(50px,-30px)scale(1.1)}50%{transform:translate(-20px,40px)scale(.95)}75%{transform:translate(-40px,-20px)scale(1.05)}}.car-mode-card{animation:.8s ease-out cardFadeIn}@keyframes cardFadeIn{0%{opacity:0;transform:translateY(30px)scale(.95)}to{opacity:1;transform:translateY(0)scale(1)}}.car-mode-progress{animation:5s linear progressFill}@keyframes progressFill{0%{width:0%}to{width:100%}}@property --tw-translate-x{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-y{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-z{syntax:"*";inherits:false;initial-value:0}@property --tw-space-y-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-gradient-position{syntax:"*";inherits:false}@property --tw-gradient-from{syntax:"";inherits:false;initial-value:#0000}@property --tw-gradient-via{syntax:"";inherits:false;initial-value:#0000}@property --tw-gradient-to{syntax:"";inherits:false;initial-value:#0000}@property --tw-gradient-stops{syntax:"*";inherits:false}@property --tw-gradient-via-stops{syntax:"*";inherits:false}@property --tw-gradient-from-position{syntax:"";inherits:false;initial-value:0%}@property --tw-gradient-via-position{syntax:"";inherits:false;initial-value:50%}@property --tw-gradient-to-position{syntax:"";inherits:false;initial-value:100%}@property --tw-leading{syntax:"*";inherits:false}@property --tw-font-weight{syntax:"*";inherits:false}@property --tw-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-shadow-color{syntax:"*";inherits:false}@property --tw-shadow-alpha{syntax:"";inherits:false;initial-value:100%}@property --tw-inset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-shadow-color{syntax:"*";inherits:false}@property --tw-inset-shadow-alpha{syntax:"";inherits:false;initial-value:100%}@property --tw-ring-color{syntax:"*";inherits:false}@property --tw-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-ring-color{syntax:"*";inherits:false}@property --tw-inset-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-ring-inset{syntax:"*";inherits:false}@property --tw-ring-offset-width{syntax:"";inherits:false;initial-value:0}@property --tw-ring-offset-color{syntax:"*";inherits:false;initial-value:#fff}@property --tw-ring-offset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-blur{syntax:"*";inherits:false}@property --tw-brightness{syntax:"*";inherits:false}@property --tw-contrast{syntax:"*";inherits:false}@property --tw-grayscale{syntax:"*";inherits:false}@property --tw-hue-rotate{syntax:"*";inherits:false}@property --tw-invert{syntax:"*";inherits:false}@property --tw-opacity{syntax:"*";inherits:false}@property --tw-saturate{syntax:"*";inherits:false}@property --tw-sepia{syntax:"*";inherits:false}@property --tw-drop-shadow{syntax:"*";inherits:false}@property --tw-drop-shadow-color{syntax:"*";inherits:false}@property --tw-drop-shadow-alpha{syntax:"";inherits:false;initial-value:100%}@property --tw-drop-shadow-size{syntax:"*";inherits:false}@property --tw-backdrop-blur{syntax:"*";inherits:false}@property --tw-backdrop-brightness{syntax:"*";inherits:false}@property --tw-backdrop-contrast{syntax:"*";inherits:false}@property --tw-backdrop-grayscale{syntax:"*";inherits:false}@property --tw-backdrop-hue-rotate{syntax:"*";inherits:false}@property --tw-backdrop-invert{syntax:"*";inherits:false}@property --tw-backdrop-opacity{syntax:"*";inherits:false}@property --tw-backdrop-saturate{syntax:"*";inherits:false}@property --tw-backdrop-sepia{syntax:"*";inherits:false}@property --tw-duration{syntax:"*";inherits:false}@property --tw-scale-x{syntax:"*";inherits:false;initial-value:1}@property --tw-scale-y{syntax:"*";inherits:false;initial-value:1}@property --tw-scale-z{syntax:"*";inherits:false;initial-value:1}@keyframes spin{to{transform:rotate(360deg)}} diff --git a/news-app/build/assets/index-BvWUS-em.js b/news-app/build/assets/index-BvWUS-em.js new file mode 100644 index 0000000..fc83fcb --- /dev/null +++ b/news-app/build/assets/index-BvWUS-em.js @@ -0,0 +1,190 @@ +(function(){const o=document.createElement("link").relList;if(o&&o.supports&&o.supports("modulepreload"))return;for(const r of document.querySelectorAll('link[rel="modulepreload"]'))s(r);new MutationObserver(r=>{for(const n of r)if(n.type==="childList")for(const d of n.addedNodes)d.tagName==="LINK"&&d.rel==="modulepreload"&&s(d)}).observe(document,{childList:!0,subtree:!0});function l(r){const n={};return r.integrity&&(n.integrity=r.integrity),r.referrerPolicy&&(n.referrerPolicy=r.referrerPolicy),r.crossOrigin==="use-credentials"?n.credentials="include":r.crossOrigin==="anonymous"?n.credentials="omit":n.credentials="same-origin",n}function s(r){if(r.ep)return;r.ep=!0;const n=l(r);fetch(r.href,n)}})();const x=document.querySelector("#app"),t={articles:[],groups:[],loading:!0,error:null,filter:"all",viewMode:"regular",carMode:!1,carModeIndex:0,carModeInterval:null};function M(e){const o=new Date(e),s=new Date-o,r=Math.floor(s/(1e3*60*60)),n=Math.floor(s/(1e3*60));return n<60?n+"m ago":r<24?r+"h ago":o.toLocaleDateString("en-US",{month:"short",day:"numeric"})}function b(e,o=150){return!e||e.length<=o?e||"":e.slice(0,o).trim()+"..."}const f={abc:{name:"ABC News",color:"bg-blue-100 text-blue-800"},npr:{name:"NPR",color:"bg-indigo-100 text-indigo-800"},cnn:{name:"CNN",color:"bg-orange-100 text-orange-800"},nbc:{name:"NBC News",color:"bg-purple-100 text-purple-800"},cbs:{name:"CBS News",color:"bg-emerald-100 text-emerald-800"},nytimes:{name:"NY Times",color:"bg-slate-100 text-slate-800"}};function u(e){return f[e]?.color||"bg-gray-100 text-gray-800"}function c(e){return f[e]?.name||e}const w={politics:"bg-red-100 text-red-800",business:"bg-green-100 text-green-800",technology:"bg-blue-100 text-blue-800",sports:"bg-orange-100 text-orange-800",entertainment:"bg-pink-100 text-pink-800",health:"bg-teal-100 text-teal-800",science:"bg-purple-100 text-purple-800",world:"bg-indigo-100 text-indigo-800",other:"bg-gray-100 text-gray-800"};function y(e){return w[e]||w.other}function k(e){const o=e.image?`
`:"",l=e.sources.slice(0,3).map(r=>`${c(r)}`).join(""),s=e.sources.length>3?`+${e.sources.length-3}`:"";return`
+ ${o} +
+
+ + ${e.category} + + ${e.articleCount} articles + AI Summary +
+

+ ${e.title} +

+

+ ${e.summary} +

+
+ ${l}${s} +
+
+ View source articles + +
+
+
`}function C(e){const o=e.image?`
`:"";return``}function $(){return`
+
+

${t.viewMode==="ai"?"AI is analyzing and grouping news...":"Loading latest news..."}

+
`}function j(e){return`
+
+ + +
+

Failed to load news

+

${e}

+ +
`}function v(){return`
+
+ + +
+

No articles found

+

Try selecting a different source filter.

+
`}function N(e,o,l){const s=e.sources.slice(0,4).map(n=>`${c(n)}`).join(""),r=e.sources.length>4?`+${e.sources.length-4} more`:"";return` +
+ ${e.image?` +
+ +
+ `:""} +
+
+ + ${e.category} + + ${e.articleCount} articles + AI Summary +
+

+ ${e.title} +

+

+ ${e.summary} +

+
+ ${s}${r} +
+
+ +
+
+
+
+ +
+ ${Array.from({length:l},(n,d)=>` +
+ `).join("")} +
+ `}function I(){if(t.groups.length===0)return` +
+
+
+
+
+
+

Loading AI grouped news...

+
+ +
+ `;const e=t.groups[t.carModeIndex];return` +
+
+
+
+ + + + + + + + + +
+ ${N(e,t.carModeIndex,t.groups.length)} +
+ + +
+ + + + + Car Mode +
+
+ `}function a(){if(t.carMode){x.innerHTML=I();return}const e=t.filter==="all"?t.articles:t.articles.filter(i=>i.source===t.filter),o=t.loading?"animate-spin":"",l=[...new Set(t.articles.map(i=>i.source))];let s="";t.loading?s=$():t.error?s=j(t.error):t.viewMode==="ai"?t.groups.length===0?s=v():s=t.groups.map(k).join(""):e.length===0?s=v():s=e.map(C).join("");const r=t.viewMode==="regular"?"bg-gray-900 text-white":"bg-gray-100 text-gray-700 hover:bg-gray-200",n=t.viewMode==="ai"?"bg-blue-600 text-white":"bg-blue-100 text-blue-700 hover:bg-blue-200",d=t.viewMode==="regular"?` + + ${l.map(i=>``).join("")} + `:"";x.innerHTML=`
+
+
+
+
+

News Feed

+

${t.viewMode==="ai"?"AI-grouped summaries from multiple sources":"Latest headlines from multiple sources"}

+
+
+
+ + +
+ ${d} + ${t.viewMode==="ai"?'':""} + + +
+
+
+ ${s} +
+
+
+ News aggregated from ABC, NPR, CNN, NBC, CBS & NY Times +
`}async function g(){t.loading=!0,t.error=null,a();try{const e=await fetch("/api/news");if(!e.ok)throw new Error("Failed to fetch news");const o=await e.json(),l=o.feeds.flatMap(s=>s.items).sort((s,r)=>new Date(r.pubDate)-new Date(s.pubDate));t.articles=l,t.loading=!1,o.errors&&o.errors.length>0&&console.warn("Some feeds failed:",o.errors)}catch(e){t.error=e.message,t.loading=!1}a()}async function p(){t.loading=!0,t.error=null,a();try{const e=await fetch("/api/grouped-news");if(!e.ok)throw new Error("Failed to fetch grouped news");const o=await e.json();t.groups=o.groups,t.loading=!1}catch(e){t.error=e.message,t.loading=!1}a()}window.setFilter=function(e){t.filter=e,a()};window.setViewMode=function(e){t.viewMode=e,e==="ai"&&t.groups.length===0?p():a()};window.refresh=function(){t.viewMode==="ai"?p():g()};window.clearCacheAndRefresh=async function(){t.loading=!0,t.error=null,a();try{const e=await fetch("/api/grouped-news?refresh=true");if(!e.ok)throw new Error("Failed to fetch grouped news");const o=await e.json();t.groups=o.groups,t.loading=!1}catch(e){t.error=e.message,t.loading=!1}a()};window.fetchNews=g;window.fetchGroupedNews=p;window.enterCarMode=async function(){if(t.carMode=!0,t.carModeIndex=0,a(),t.groups.length===0)try{const e=await fetch("/api/grouped-news");if(!e.ok)throw new Error("Failed to fetch grouped news");const o=await e.json();t.groups=o.groups,a()}catch(e){console.error("Failed to load grouped news for car mode:",e)}h()};window.exitCarMode=function(){t.carMode=!1,m(),a()};window.carModeNext=function(){t.groups.length!==0&&(t.carModeIndex=(t.carModeIndex+1)%t.groups.length,m(),a(),h())};window.carModePrev=function(){t.groups.length!==0&&(t.carModeIndex=(t.carModeIndex-1+t.groups.length)%t.groups.length,m(),a(),h())};function h(){m(),t.carModeInterval=setInterval(()=>{t.groups.length>0&&(t.carModeIndex=(t.carModeIndex+1)%t.groups.length,a())},5e3)}function m(){t.carModeInterval&&(clearInterval(t.carModeInterval),t.carModeInterval=null)}document.addEventListener("keydown",e=>{if(t.carMode)switch(e.key){case"Escape":window.exitCarMode();break;case"ArrowRight":case" ":window.carModeNext();break;case"ArrowLeft":window.carModePrev();break}});g();setInterval(()=>{t.viewMode==="ai"?p():g()},300*1e3); diff --git a/news-app/build/index.html b/news-app/build/index.html new file mode 100644 index 0000000..dc1df58 --- /dev/null +++ b/news-app/build/index.html @@ -0,0 +1,14 @@ + + + + + + + News Feed - Yahoo & ABC News + + + + +
+ + diff --git a/news-app/build/vite.svg b/news-app/build/vite.svg new file mode 100644 index 0000000..e7b8dfb --- /dev/null +++ b/news-app/build/vite.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/news-app/com.je.carnews.plist b/news-app/com.je.carnews.plist new file mode 100644 index 0000000..fd32620 --- /dev/null +++ b/news-app/com.je.carnews.plist @@ -0,0 +1,34 @@ + + + + + Label + com.je.carnews + ProgramArguments + + /Users/jared/.nvm/versions/node/v22.19.0/bin/node + /opt/homebrew/var/www/news-app/server.js + + WorkingDirectory + /opt/homebrew/var/www/news-app + UserName + jared + GroupName + staff + RunAtLoad + + KeepAlive + + StandardOutPath + /opt/homebrew/var/www/news-app/logs/out.log + StandardErrorPath + /opt/homebrew/var/www/news-app/logs/error.log + EnvironmentVariables + + PATH + /opt/homebrew/bin:/usr/bin:/bin + OPENAI_API_KEY + 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 + + + diff --git a/news-app/for_ubuntu.txt b/news-app/for_ubuntu.txt new file mode 100644 index 0000000..36ca44b --- /dev/null +++ b/news-app/for_ubuntu.txt @@ -0,0 +1,62 @@ +Based on the codebase analysis, here's what needs to change for your Ubuntu deployment: + + Required Changes + + Create a systemd service file instead: + + # /etc/systemd/system/carnews.service + [Unit] + Description=Car News API Server + After=network.target + + [Service] + Type=simple + User= + WorkingDirectory=/path/to/news-app + ExecStart=/usr/bin/node server.js + Restart=on-failure + EnvironmentFile=/path/to/news-app/.env + + [Install] + WantedBy=multi-user.target + + 2. Rebuild native modules + + The better-sqlite3 package requires recompilation on Ubuntu: + npm rebuild better-sqlite3 + + 3. Nginx configuration for Ubuntu + + You'll need to create an Nginx config (not included in this repo). Example: + + location /carnews/ { + alias /path/to/news-app/dist/; + try_files $uri $uri/ /carnews/index.html; + } + + location /carnews/api/ { + proxy_pass http://localhost:5555/api/; + proxy_http_version 1.1; + proxy_set_header Host $host; + } + + 4. Update paths if directory structure differs + + Current macOS path: /opt/homebrew/var/www/news-app + On Ubuntu you might use: /var/www/news-app or similar + + No Changes Needed + + - vite.config.js - base: '/carnews/' stays the same + - server.js - Port 5555 works as-is + - .env file - Copy it over + - All source code - Uses relative paths + + Deployment Steps + + 1. Copy the codebase to Ubuntu + 2. Run npm install and npm rebuild better-sqlite3 + 3. Run npm run build to generate fresh /dist files + 4. Create the systemd service file + 5. Configure Nginx with the proxy rules + 6. Enable and start the service: sudo systemctl enable --now carnews diff --git a/news-app/index.html b/news-app/index.html new file mode 100644 index 0000000..ee409af --- /dev/null +++ b/news-app/index.html @@ -0,0 +1,13 @@ + + + + + + + News Feed - Yahoo & ABC News + + +
+ + + diff --git a/news-app/package-lock.json b/news-app/package-lock.json new file mode 100644 index 0000000..b31be9b --- /dev/null +++ b/news-app/package-lock.json @@ -0,0 +1,3289 @@ +{ + "name": "news-app", + "version": "0.0.0", + "lockfileVersion": 3, + "requires": true, + "packages": { + "": { + "name": "news-app", + "version": "0.0.0", + "dependencies": { + "better-sqlite3": "^12.6.2", + "cors": "^2.8.6", + "dotenv": "^17.2.3", + "express": "^5.2.1", + "openai": "^6.16.0", + "rss-parser": "^3.13.0" + }, + "devDependencies": { + "@tailwindcss/vite": "^4.1.18", + "autoprefixer": "^10.4.23", + "postcss": "^8.5.6", + "tailwindcss": "^4.1.18", + "vite": "^7.2.4" + } + }, + "node_modules/@esbuild/aix-ppc64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/aix-ppc64/-/aix-ppc64-0.27.2.tgz", + "integrity": "sha512-GZMB+a0mOMZs4MpDbj8RJp4cw+w1WV5NYD6xzgvzUJ5Ek2jerwfO2eADyI6ExDSUED+1X8aMbegahsJi+8mgpw==", + "cpu": [ + "ppc64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "aix" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/android-arm": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.27.2.tgz", + "integrity": "sha512-DVNI8jlPa7Ujbr1yjU2PfUSRtAUZPG9I1RwW4F4xFB1Imiu2on0ADiI/c3td+KmDtVKNbi+nffGDQMfcIMkwIA==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/android-arm64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.27.2.tgz", + "integrity": "sha512-pvz8ZZ7ot/RBphf8fv60ljmaoydPU12VuXHImtAs0XhLLw+EXBi2BLe3OYSBslR4rryHvweW5gmkKFwTiFy6KA==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/android-x64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.27.2.tgz", + "integrity": "sha512-z8Ank4Byh4TJJOh4wpz8g2vDy75zFL0TlZlkUkEwYXuPSgX8yzep596n6mT7905kA9uHZsf/o2OJZubl2l3M7A==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/darwin-arm64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.27.2.tgz", + "integrity": "sha512-davCD2Zc80nzDVRwXTcQP/28fiJbcOwvdolL0sOiOsbwBa72kegmVU0Wrh1MYrbuCL98Omp5dVhQFWRKR2ZAlg==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/darwin-x64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.27.2.tgz", + "integrity": "sha512-ZxtijOmlQCBWGwbVmwOF/UCzuGIbUkqB1faQRf5akQmxRJ1ujusWsb3CVfk/9iZKr2L5SMU5wPBi1UWbvL+VQA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/freebsd-arm64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.27.2.tgz", + "integrity": "sha512-lS/9CN+rgqQ9czogxlMcBMGd+l8Q3Nj1MFQwBZJyoEKI50XGxwuzznYdwcav6lpOGv5BqaZXqvBSiB/kJ5op+g==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/freebsd-x64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.27.2.tgz", + "integrity": "sha512-tAfqtNYb4YgPnJlEFu4c212HYjQWSO/w/h/lQaBK7RbwGIkBOuNKQI9tqWzx7Wtp7bTPaGC6MJvWI608P3wXYA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-arm": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.27.2.tgz", + "integrity": "sha512-vWfq4GaIMP9AIe4yj1ZUW18RDhx6EPQKjwe7n8BbIecFtCQG4CfHGaHuh7fdfq+y3LIA2vGS/o9ZBGVxIDi9hw==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-arm64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.27.2.tgz", + "integrity": "sha512-hYxN8pr66NsCCiRFkHUAsxylNOcAQaxSSkHMMjcpx0si13t1LHFphxJZUiGwojB1a/Hd5OiPIqDdXONia6bhTw==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-ia32": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.27.2.tgz", + "integrity": "sha512-MJt5BRRSScPDwG2hLelYhAAKh9imjHK5+NE/tvnRLbIqUWa+0E9N4WNMjmp/kXXPHZGqPLxggwVhz7QP8CTR8w==", + "cpu": [ + "ia32" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-loong64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.27.2.tgz", + "integrity": "sha512-lugyF1atnAT463aO6KPshVCJK5NgRnU4yb3FUumyVz+cGvZbontBgzeGFO1nF+dPueHD367a2ZXe1NtUkAjOtg==", + "cpu": [ + "loong64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-mips64el": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.27.2.tgz", + "integrity": "sha512-nlP2I6ArEBewvJ2gjrrkESEZkB5mIoaTswuqNFRv/WYd+ATtUpe9Y09RnJvgvdag7he0OWgEZWhviS1OTOKixw==", + "cpu": [ + "mips64el" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-ppc64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.27.2.tgz", + "integrity": "sha512-C92gnpey7tUQONqg1n6dKVbx3vphKtTHJaNG2Ok9lGwbZil6DrfyecMsp9CrmXGQJmZ7iiVXvvZH6Ml5hL6XdQ==", + "cpu": [ + "ppc64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-riscv64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.27.2.tgz", + "integrity": "sha512-B5BOmojNtUyN8AXlK0QJyvjEZkWwy/FKvakkTDCziX95AowLZKR6aCDhG7LeF7uMCXEJqwa8Bejz5LTPYm8AvA==", + "cpu": [ + "riscv64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-s390x": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.27.2.tgz", + "integrity": "sha512-p4bm9+wsPwup5Z8f4EpfN63qNagQ47Ua2znaqGH6bqLlmJ4bx97Y9JdqxgGZ6Y8xVTixUnEkoKSHcpRlDnNr5w==", + "cpu": [ + "s390x" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-x64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.27.2.tgz", + "integrity": "sha512-uwp2Tip5aPmH+NRUwTcfLb+W32WXjpFejTIOWZFw/v7/KnpCDKG66u4DLcurQpiYTiYwQ9B7KOeMJvLCu/OvbA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/netbsd-arm64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-arm64/-/netbsd-arm64-0.27.2.tgz", + "integrity": "sha512-Kj6DiBlwXrPsCRDeRvGAUb/LNrBASrfqAIok+xB0LxK8CHqxZ037viF13ugfsIpePH93mX7xfJp97cyDuTZ3cw==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/netbsd-x64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.27.2.tgz", + "integrity": "sha512-HwGDZ0VLVBY3Y+Nw0JexZy9o/nUAWq9MlV7cahpaXKW6TOzfVno3y3/M8Ga8u8Yr7GldLOov27xiCnqRZf0tCA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/openbsd-arm64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-arm64/-/openbsd-arm64-0.27.2.tgz", + "integrity": "sha512-DNIHH2BPQ5551A7oSHD0CKbwIA/Ox7+78/AWkbS5QoRzaqlev2uFayfSxq68EkonB+IKjiuxBFoV8ESJy8bOHA==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/openbsd-x64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.27.2.tgz", + "integrity": "sha512-/it7w9Nb7+0KFIzjalNJVR5bOzA9Vay+yIPLVHfIQYG/j+j9VTH84aNB8ExGKPU4AzfaEvN9/V4HV+F+vo8OEg==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/openharmony-arm64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/openharmony-arm64/-/openharmony-arm64-0.27.2.tgz", + "integrity": "sha512-LRBbCmiU51IXfeXk59csuX/aSaToeG7w48nMwA6049Y4J4+VbWALAuXcs+qcD04rHDuSCSRKdmY63sruDS5qag==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "openharmony" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/sunos-x64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.27.2.tgz", + "integrity": "sha512-kMtx1yqJHTmqaqHPAzKCAkDaKsffmXkPHThSfRwZGyuqyIeBvf08KSsYXl+abf5HDAPMJIPnbBfXvP2ZC2TfHg==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "sunos" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/win32-arm64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.27.2.tgz", + "integrity": "sha512-Yaf78O/B3Kkh+nKABUF++bvJv5Ijoy9AN1ww904rOXZFLWVc5OLOfL56W+C8F9xn5JQZa3UX6m+IktJnIb1Jjg==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/win32-ia32": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.27.2.tgz", + "integrity": "sha512-Iuws0kxo4yusk7sw70Xa2E2imZU5HoixzxfGCdxwBdhiDgt9vX9VUCBhqcwY7/uh//78A1hMkkROMJq9l27oLQ==", + "cpu": [ + "ia32" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/win32-x64": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.27.2.tgz", + "integrity": "sha512-sRdU18mcKf7F+YgheI/zGf5alZatMUTKj/jNS6l744f9u3WFu4v7twcUI9vu4mknF4Y9aDlblIie0IM+5xxaqQ==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@jridgewell/gen-mapping": { + "version": "0.3.13", + "resolved": "https://registry.npmjs.org/@jridgewell/gen-mapping/-/gen-mapping-0.3.13.tgz", + "integrity": "sha512-2kkt/7niJ6MgEPxF0bYdQ6etZaA+fQvDcLKckhy1yIQOzaoKjBBjSj63/aLVjYE3qhRt5dvM+uUyfCg6UKCBbA==", + "dev": true, + "license": "MIT", + "dependencies": { + "@jridgewell/sourcemap-codec": "^1.5.0", + "@jridgewell/trace-mapping": "^0.3.24" + } + }, + "node_modules/@jridgewell/remapping": { + "version": "2.3.5", + "resolved": "https://registry.npmjs.org/@jridgewell/remapping/-/remapping-2.3.5.tgz", + "integrity": "sha512-LI9u/+laYG4Ds1TDKSJW2YPrIlcVYOwi2fUC6xB43lueCjgxV4lffOCZCtYFiH6TNOX+tQKXx97T4IKHbhyHEQ==", + "dev": true, + "license": "MIT", + "dependencies": { + "@jridgewell/gen-mapping": "^0.3.5", + "@jridgewell/trace-mapping": "^0.3.24" + } + }, + "node_modules/@jridgewell/resolve-uri": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.2.tgz", + "integrity": "sha512-bRISgCIjP20/tbWSPWMEi54QVPRZExkuD9lJL+UIxUKtwVJA8wW1Trb1jMs1RFXo1CBTNZ/5hpC9QvmKWdopKw==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/sourcemap-codec": { + "version": "1.5.5", + "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.5.5.tgz", + "integrity": "sha512-cYQ9310grqxueWbl+WuIUIaiUaDcj7WOq5fVhEljNVgRfOUhY9fy2zTvfoqWsnebh8Sl70VScFbICvJnLKB0Og==", + "dev": true, + "license": "MIT" + }, + "node_modules/@jridgewell/trace-mapping": { + "version": "0.3.31", + "resolved": "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.31.tgz", + "integrity": "sha512-zzNR+SdQSDJzc8joaeP8QQoCQr8NuYx2dIIytl1QeBEZHJ9uW6hebsrYgbz8hJwUQao3TWCMtmfV8Nu1twOLAw==", + "dev": true, + "license": "MIT", + "dependencies": { + "@jridgewell/resolve-uri": "^3.1.0", + "@jridgewell/sourcemap-codec": "^1.4.14" + } + }, + "node_modules/@rollup/rollup-android-arm-eabi": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.56.0.tgz", + "integrity": "sha512-LNKIPA5k8PF1+jAFomGe3qN3bbIgJe/IlpDBwuVjrDKrJhVWywgnJvflMt/zkbVNLFtF1+94SljYQS6e99klnw==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "android" + ] + }, + "node_modules/@rollup/rollup-android-arm64": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.56.0.tgz", + "integrity": "sha512-lfbVUbelYqXlYiU/HApNMJzT1E87UPGvzveGg2h0ktUNlOCxKlWuJ9jtfvs1sKHdwU4fzY7Pl8sAl49/XaEk6Q==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "android" + ] + }, + "node_modules/@rollup/rollup-darwin-arm64": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.56.0.tgz", + "integrity": "sha512-EgxD1ocWfhoD6xSOeEEwyE7tDvwTgZc8Bss7wCWe+uc7wO8G34HHCUH+Q6cHqJubxIAnQzAsyUsClt0yFLu06w==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "darwin" + ] + }, + "node_modules/@rollup/rollup-darwin-x64": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.56.0.tgz", + "integrity": "sha512-1vXe1vcMOssb/hOF8iv52A7feWW2xnu+c8BV4t1F//m9QVLTfNVpEdja5ia762j/UEJe2Z1jAmEqZAK42tVW3g==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "darwin" + ] + }, + "node_modules/@rollup/rollup-freebsd-arm64": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-freebsd-arm64/-/rollup-freebsd-arm64-4.56.0.tgz", + "integrity": "sha512-bof7fbIlvqsyv/DtaXSck4VYQ9lPtoWNFCB/JY4snlFuJREXfZnm+Ej6yaCHfQvofJDXLDMTVxWscVSuQvVWUQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "freebsd" + ] + }, + "node_modules/@rollup/rollup-freebsd-x64": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-freebsd-x64/-/rollup-freebsd-x64-4.56.0.tgz", + "integrity": "sha512-KNa6lYHloW+7lTEkYGa37fpvPq+NKG/EHKM8+G/g9WDU7ls4sMqbVRV78J6LdNuVaeeK5WB9/9VAFbKxcbXKYg==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "freebsd" + ] + }, + "node_modules/@rollup/rollup-linux-arm-gnueabihf": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.56.0.tgz", + "integrity": "sha512-E8jKK87uOvLrrLN28jnAAAChNq5LeCd2mGgZF+fGF5D507WlG/Noct3lP/QzQ6MrqJ5BCKNwI9ipADB6jyiq2A==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm-musleabihf": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.56.0.tgz", + "integrity": "sha512-jQosa5FMYF5Z6prEpTCCmzCXz6eKr/tCBssSmQGEeozA9tkRUty/5Vx06ibaOP9RCrW1Pvb8yp3gvZhHwTDsJw==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm64-gnu": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.56.0.tgz", + "integrity": "sha512-uQVoKkrC1KGEV6udrdVahASIsaF8h7iLG0U0W+Xn14ucFwi6uS539PsAr24IEF9/FoDtzMeeJXJIBo5RkbNWvQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm64-musl": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.56.0.tgz", + "integrity": "sha512-vLZ1yJKLxhQLFKTs42RwTwa6zkGln+bnXc8ueFGMYmBTLfNu58sl5/eXyxRa2RarTkJbXl8TKPgfS6V5ijNqEA==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-loong64-gnu": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-loong64-gnu/-/rollup-linux-loong64-gnu-4.56.0.tgz", + "integrity": "sha512-FWfHOCub564kSE3xJQLLIC/hbKqHSVxy8vY75/YHHzWvbJL7aYJkdgwD/xGfUlL5UV2SB7otapLrcCj2xnF1dg==", + "cpu": [ + "loong64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-loong64-musl": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-loong64-musl/-/rollup-linux-loong64-musl-4.56.0.tgz", + "integrity": "sha512-z1EkujxIh7nbrKL1lmIpqFTc/sr0u8Uk0zK/qIEFldbt6EDKWFk/pxFq3gYj4Bjn3aa9eEhYRlL3H8ZbPT1xvA==", + "cpu": [ + "loong64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-ppc64-gnu": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-ppc64-gnu/-/rollup-linux-ppc64-gnu-4.56.0.tgz", + "integrity": "sha512-iNFTluqgdoQC7AIE8Q34R3AuPrJGJirj5wMUErxj22deOcY7XwZRaqYmB6ZKFHoVGqRcRd0mqO+845jAibKCkw==", + "cpu": [ + "ppc64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-ppc64-musl": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-ppc64-musl/-/rollup-linux-ppc64-musl-4.56.0.tgz", + "integrity": "sha512-MtMeFVlD2LIKjp2sE2xM2slq3Zxf9zwVuw0jemsxvh1QOpHSsSzfNOTH9uYW9i1MXFxUSMmLpeVeUzoNOKBaWg==", + "cpu": [ + "ppc64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-riscv64-gnu": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.56.0.tgz", + "integrity": "sha512-in+v6wiHdzzVhYKXIk5U74dEZHdKN9KH0Q4ANHOTvyXPG41bajYRsy7a8TPKbYPl34hU7PP7hMVHRvv/5aCSew==", + "cpu": [ + "riscv64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-riscv64-musl": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-musl/-/rollup-linux-riscv64-musl-4.56.0.tgz", + "integrity": "sha512-yni2raKHB8m9NQpI9fPVwN754mn6dHQSbDTwxdr9SE0ks38DTjLMMBjrwvB5+mXrX+C0npX0CVeCUcvvvD8CNQ==", + "cpu": [ + "riscv64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-s390x-gnu": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.56.0.tgz", + "integrity": "sha512-zhLLJx9nQPu7wezbxt2ut+CI4YlXi68ndEve16tPc/iwoylWS9B3FxpLS2PkmfYgDQtosah07Mj9E0khc3Y+vQ==", + "cpu": [ + "s390x" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-x64-gnu": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.56.0.tgz", + "integrity": "sha512-MVC6UDp16ZSH7x4rtuJPAEoE1RwS8N4oK9DLHy3FTEdFoUTCFVzMfJl/BVJ330C+hx8FfprA5Wqx4FhZXkj2Kw==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-x64-musl": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.56.0.tgz", + "integrity": "sha512-ZhGH1eA4Qv0lxaV00azCIS1ChedK0V32952Md3FtnxSqZTBTd6tgil4nZT5cU8B+SIw3PFYkvyR4FKo2oyZIHA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-openbsd-x64": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-openbsd-x64/-/rollup-openbsd-x64-4.56.0.tgz", + "integrity": "sha512-O16XcmyDeFI9879pEcmtWvD/2nyxR9mF7Gs44lf1vGGx8Vg2DRNx11aVXBEqOQhWb92WN4z7fW/q4+2NYzCbBA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "openbsd" + ] + }, + "node_modules/@rollup/rollup-openharmony-arm64": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-openharmony-arm64/-/rollup-openharmony-arm64-4.56.0.tgz", + "integrity": "sha512-LhN/Reh+7F3RCgQIRbgw8ZMwUwyqJM+8pXNT6IIJAqm2IdKkzpCh/V9EdgOMBKuebIrzswqy4ATlrDgiOwbRcQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "openharmony" + ] + }, + "node_modules/@rollup/rollup-win32-arm64-msvc": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.56.0.tgz", + "integrity": "sha512-kbFsOObXp3LBULg1d3JIUQMa9Kv4UitDmpS+k0tinPBz3watcUiV2/LUDMMucA6pZO3WGE27P7DsfaN54l9ing==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-ia32-msvc": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.56.0.tgz", + "integrity": "sha512-vSSgny54D6P4vf2izbtFm/TcWYedw7f8eBrOiGGecyHyQB9q4Kqentjaj8hToe+995nob/Wv48pDqL5a62EWtg==", + "cpu": [ + "ia32" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-x64-gnu": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-x64-gnu/-/rollup-win32-x64-gnu-4.56.0.tgz", + "integrity": "sha512-FeCnkPCTHQJFbiGG49KjV5YGW/8b9rrXAM2Mz2kiIoktq2qsJxRD5giEMEOD2lPdgs72upzefaUvS+nc8E3UzQ==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-x64-msvc": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.56.0.tgz", + "integrity": "sha512-H8AE9Ur/t0+1VXujj90w0HrSOuv0Nq9r1vSZF2t5km20NTfosQsGGUXDaKdQZzwuLts7IyL1fYT4hM95TI9c4g==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@tailwindcss/node": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/node/-/node-4.1.18.tgz", + "integrity": "sha512-DoR7U1P7iYhw16qJ49fgXUlry1t4CpXeErJHnQ44JgTSKMaZUdf17cfn5mHchfJ4KRBZRFA/Coo+MUF5+gOaCQ==", + "dev": true, + "license": "MIT", + "dependencies": { + "@jridgewell/remapping": "^2.3.4", + "enhanced-resolve": "^5.18.3", + "jiti": "^2.6.1", + "lightningcss": "1.30.2", + "magic-string": "^0.30.21", + "source-map-js": "^1.2.1", + "tailwindcss": "4.1.18" + } + }, + "node_modules/@tailwindcss/oxide": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide/-/oxide-4.1.18.tgz", + "integrity": "sha512-EgCR5tTS5bUSKQgzeMClT6iCY3ToqE1y+ZB0AKldj809QXk1Y+3jB0upOYZrn9aGIzPtUsP7sX4QQ4XtjBB95A==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">= 10" + }, + "optionalDependencies": { + "@tailwindcss/oxide-android-arm64": "4.1.18", + "@tailwindcss/oxide-darwin-arm64": "4.1.18", + "@tailwindcss/oxide-darwin-x64": "4.1.18", + "@tailwindcss/oxide-freebsd-x64": "4.1.18", + "@tailwindcss/oxide-linux-arm-gnueabihf": "4.1.18", + "@tailwindcss/oxide-linux-arm64-gnu": "4.1.18", + "@tailwindcss/oxide-linux-arm64-musl": "4.1.18", + "@tailwindcss/oxide-linux-x64-gnu": "4.1.18", + "@tailwindcss/oxide-linux-x64-musl": "4.1.18", + "@tailwindcss/oxide-wasm32-wasi": "4.1.18", + "@tailwindcss/oxide-win32-arm64-msvc": "4.1.18", + "@tailwindcss/oxide-win32-x64-msvc": "4.1.18" + } + }, + "node_modules/@tailwindcss/oxide-android-arm64": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-android-arm64/-/oxide-android-arm64-4.1.18.tgz", + "integrity": "sha512-dJHz7+Ugr9U/diKJA0W6N/6/cjI+ZTAoxPf9Iz9BFRF2GzEX8IvXxFIi/dZBloVJX/MZGvRuFA9rqwdiIEZQ0Q==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-darwin-arm64": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-darwin-arm64/-/oxide-darwin-arm64-4.1.18.tgz", + "integrity": "sha512-Gc2q4Qhs660bhjyBSKgq6BYvwDz4G+BuyJ5H1xfhmDR3D8HnHCmT/BSkvSL0vQLy/nkMLY20PQ2OoYMO15Jd0A==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-darwin-x64": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-darwin-x64/-/oxide-darwin-x64-4.1.18.tgz", + "integrity": "sha512-FL5oxr2xQsFrc3X9o1fjHKBYBMD1QZNyc1Xzw/h5Qu4XnEBi3dZn96HcHm41c/euGV+GRiXFfh2hUCyKi/e+yw==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-freebsd-x64": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-freebsd-x64/-/oxide-freebsd-x64-4.1.18.tgz", + "integrity": "sha512-Fj+RHgu5bDodmV1dM9yAxlfJwkkWvLiRjbhuO2LEtwtlYlBgiAT4x/j5wQr1tC3SANAgD+0YcmWVrj8R9trVMA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-arm-gnueabihf": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm-gnueabihf/-/oxide-linux-arm-gnueabihf-4.1.18.tgz", + "integrity": "sha512-Fp+Wzk/Ws4dZn+LV2Nqx3IilnhH51YZoRaYHQsVq3RQvEl+71VGKFpkfHrLM/Li+kt5c0DJe/bHXK1eHgDmdiA==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-arm64-gnu": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm64-gnu/-/oxide-linux-arm64-gnu-4.1.18.tgz", + "integrity": "sha512-S0n3jboLysNbh55Vrt7pk9wgpyTTPD0fdQeh7wQfMqLPM/Hrxi+dVsLsPrycQjGKEQk85Kgbx+6+QnYNiHalnw==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-arm64-musl": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm64-musl/-/oxide-linux-arm64-musl-4.1.18.tgz", + "integrity": "sha512-1px92582HkPQlaaCkdRcio71p8bc8i/ap5807tPRDK/uw953cauQBT8c5tVGkOwrHMfc2Yh6UuxaH4vtTjGvHg==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-x64-gnu": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-x64-gnu/-/oxide-linux-x64-gnu-4.1.18.tgz", + "integrity": "sha512-v3gyT0ivkfBLoZGF9LyHmts0Isc8jHZyVcbzio6Wpzifg/+5ZJpDiRiUhDLkcr7f/r38SWNe7ucxmGW3j3Kb/g==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-x64-musl": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-x64-musl/-/oxide-linux-x64-musl-4.1.18.tgz", + "integrity": "sha512-bhJ2y2OQNlcRwwgOAGMY0xTFStt4/wyU6pvI6LSuZpRgKQwxTec0/3Scu91O8ir7qCR3AuepQKLU/kX99FouqQ==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-wasm32-wasi": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-wasm32-wasi/-/oxide-wasm32-wasi-4.1.18.tgz", + "integrity": "sha512-LffYTvPjODiP6PT16oNeUQJzNVyJl1cjIebq/rWWBF+3eDst5JGEFSc5cWxyRCJ0Mxl+KyIkqRxk1XPEs9x8TA==", + "bundleDependencies": [ + "@napi-rs/wasm-runtime", + "@emnapi/core", + "@emnapi/runtime", + "@tybys/wasm-util", + "@emnapi/wasi-threads", + "tslib" + ], + "cpu": [ + "wasm32" + ], + "dev": true, + "license": "MIT", + "optional": true, + "dependencies": { + "@emnapi/core": "^1.7.1", + "@emnapi/runtime": "^1.7.1", + "@emnapi/wasi-threads": "^1.1.0", + "@napi-rs/wasm-runtime": "^1.1.0", + "@tybys/wasm-util": "^0.10.1", + "tslib": "^2.4.0" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/@tailwindcss/oxide-win32-arm64-msvc": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-win32-arm64-msvc/-/oxide-win32-arm64-msvc-4.1.18.tgz", + "integrity": "sha512-HjSA7mr9HmC8fu6bdsZvZ+dhjyGCLdotjVOgLA2vEqxEBZaQo9YTX4kwgEvPCpRh8o4uWc4J/wEoFzhEmjvPbA==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-win32-x64-msvc": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-win32-x64-msvc/-/oxide-win32-x64-msvc-4.1.18.tgz", + "integrity": "sha512-bJWbyYpUlqamC8dpR7pfjA0I7vdF6t5VpUGMWRkXVE3AXgIZjYUYAK7II1GNaxR8J1SSrSrppRar8G++JekE3Q==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/vite": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/@tailwindcss/vite/-/vite-4.1.18.tgz", + "integrity": "sha512-jVA+/UpKL1vRLg6Hkao5jldawNmRo7mQYrZtNHMIVpLfLhDml5nMRUo/8MwoX2vNXvnaXNNMedrMfMugAVX1nA==", + "dev": true, + "license": "MIT", + "dependencies": { + "@tailwindcss/node": "4.1.18", + "@tailwindcss/oxide": "4.1.18", + "tailwindcss": "4.1.18" + }, + "peerDependencies": { + "vite": "^5.2.0 || ^6 || ^7" + } + }, + "node_modules/@types/estree": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/@types/estree/-/estree-1.0.8.tgz", + "integrity": "sha512-dWHzHa2WqEXI/O1E9OjrocMTKJl2mSrEolh1Iomrv6U+JuNwaHXsXx9bLu5gG7BUWFIN0skIQJQ/L1rIex4X6w==", + "dev": true, + "license": "MIT" + }, + "node_modules/accepts": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-2.0.0.tgz", + "integrity": "sha512-5cvg6CtKwfgdmVqY1WIiXKc3Q1bkRqGLi+2W/6ao+6Y7gu/RCwRuAhGEzh5B4KlszSuTLgZYuqFqo5bImjNKng==", + "license": "MIT", + "dependencies": { + "mime-types": "^3.0.0", + "negotiator": "^1.0.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/autoprefixer": { + "version": "10.4.23", + "resolved": "https://registry.npmjs.org/autoprefixer/-/autoprefixer-10.4.23.tgz", + "integrity": "sha512-YYTXSFulfwytnjAPlw8QHncHJmlvFKtczb8InXaAx9Q0LbfDnfEYDE55omerIJKihhmU61Ft+cAOSzQVaBUmeA==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/autoprefixer" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "license": "MIT", + "dependencies": { + "browserslist": "^4.28.1", + "caniuse-lite": "^1.0.30001760", + "fraction.js": "^5.3.4", + "picocolors": "^1.1.1", + "postcss-value-parser": "^4.2.0" + }, + "bin": { + "autoprefixer": "bin/autoprefixer" + }, + "engines": { + "node": "^10 || ^12 || >=14" + }, + "peerDependencies": { + "postcss": "^8.1.0" + } + }, + "node_modules/base64-js": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.5.1.tgz", + "integrity": "sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "MIT" + }, + "node_modules/baseline-browser-mapping": { + "version": "2.9.18", + "resolved": "https://registry.npmjs.org/baseline-browser-mapping/-/baseline-browser-mapping-2.9.18.tgz", + "integrity": "sha512-e23vBV1ZLfjb9apvfPk4rHVu2ry6RIr2Wfs+O324okSidrX7pTAnEJPCh/O5BtRlr7QtZI7ktOP3vsqr7Z5XoA==", + "dev": true, + "license": "Apache-2.0", + "bin": { + "baseline-browser-mapping": "dist/cli.js" + } + }, + "node_modules/better-sqlite3": { + "version": "12.6.2", + "resolved": "https://registry.npmjs.org/better-sqlite3/-/better-sqlite3-12.6.2.tgz", + "integrity": "sha512-8VYKM3MjCa9WcaSAI3hzwhmyHVlH8tiGFwf0RlTsZPWJ1I5MkzjiudCo4KC4DxOaL/53A5B1sI/IbldNFDbsKA==", + "hasInstallScript": true, + "license": "MIT", + "dependencies": { + "bindings": "^1.5.0", + "prebuild-install": "^7.1.1" + }, + "engines": { + "node": "20.x || 22.x || 23.x || 24.x || 25.x" + } + }, + "node_modules/bindings": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/bindings/-/bindings-1.5.0.tgz", + "integrity": "sha512-p2q/t/mhvuOj/UeLlV6566GD/guowlr0hHxClI0W9m7MWYkL1F0hLo+0Aexs9HSPCtR1SXQ0TD3MMKrXZajbiQ==", + "license": "MIT", + "dependencies": { + "file-uri-to-path": "1.0.0" + } + }, + "node_modules/bl": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/bl/-/bl-4.1.0.tgz", + "integrity": "sha512-1W07cM9gS6DcLperZfFSj+bWLtaPGSOHWhPiGzXmvVJbRLdG82sH/Kn8EtW1VqWVA54AKf2h5k5BbnIbwF3h6w==", + "license": "MIT", + "dependencies": { + "buffer": "^5.5.0", + "inherits": "^2.0.4", + "readable-stream": "^3.4.0" + } + }, + "node_modules/body-parser": { + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-2.2.2.tgz", + "integrity": "sha512-oP5VkATKlNwcgvxi0vM0p/D3n2C3EReYVX+DNYs5TjZFn/oQt2j+4sVJtSMr18pdRr8wjTcBl6LoV+FUwzPmNA==", + "license": "MIT", + "dependencies": { + "bytes": "^3.1.2", + "content-type": "^1.0.5", + "debug": "^4.4.3", + "http-errors": "^2.0.0", + "iconv-lite": "^0.7.0", + "on-finished": "^2.4.1", + "qs": "^6.14.1", + "raw-body": "^3.0.1", + "type-is": "^2.0.1" + }, + "engines": { + "node": ">=18" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/browserslist": { + "version": "4.28.1", + "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.28.1.tgz", + "integrity": "sha512-ZC5Bd0LgJXgwGqUknZY/vkUQ04r8NXnJZ3yYi4vDmSiZmC/pdSN0NbNRPxZpbtO4uAfDUAFffO8IZoM3Gj8IkA==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "license": "MIT", + "dependencies": { + "baseline-browser-mapping": "^2.9.0", + "caniuse-lite": "^1.0.30001759", + "electron-to-chromium": "^1.5.263", + "node-releases": "^2.0.27", + "update-browserslist-db": "^1.2.0" + }, + "bin": { + "browserslist": "cli.js" + }, + "engines": { + "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" + } + }, + "node_modules/buffer": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/buffer/-/buffer-5.7.1.tgz", + "integrity": "sha512-EHcyIPBQ4BSGlvjB16k5KgAJ27CIsHY/2JBmCRReo48y9rQ3MaUzWX3KVlBa4U7MyX02HdVj0K7C3WaB3ju7FQ==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "MIT", + "dependencies": { + "base64-js": "^1.3.1", + "ieee754": "^1.1.13" + } + }, + "node_modules/bytes": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz", + "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/call-bind-apply-helpers": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/call-bind-apply-helpers/-/call-bind-apply-helpers-1.0.2.tgz", + "integrity": "sha512-Sp1ablJ0ivDkSzjcaJdxEunN5/XvksFJ2sMBFfq6x0ryhQV/2b/KwFe21cMpmHtPOSij8K99/wSfoEuTObmuMQ==", + "license": "MIT", + "dependencies": { + "es-errors": "^1.3.0", + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/call-bound": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/call-bound/-/call-bound-1.0.4.tgz", + "integrity": "sha512-+ys997U96po4Kx/ABpBCqhA9EuxJaQWDQg7295H4hBphv3IZg0boBKuwYpt4YXp6MZ5AmZQnU/tyMTlRpaSejg==", + "license": "MIT", + "dependencies": { + "call-bind-apply-helpers": "^1.0.2", + "get-intrinsic": "^1.3.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/caniuse-lite": { + "version": "1.0.30001766", + "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001766.tgz", + "integrity": "sha512-4C0lfJ0/YPjJQHagaE9x2Elb69CIqEPZeG0anQt9SIvIoOH4a4uaRl73IavyO+0qZh6MDLH//DrXThEYKHkmYA==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/caniuse-lite" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "license": "CC-BY-4.0" + }, + "node_modules/chownr": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.4.tgz", + "integrity": "sha512-jJ0bqzaylmJtVnNgzTeSOs8DPavpbYgEr/b0YL8/2GO3xJEhInFmhKMUnEJQjZumK7KXGFhUy89PrsJWlakBVg==", + "license": "ISC" + }, + "node_modules/content-disposition": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-1.0.1.tgz", + "integrity": "sha512-oIXISMynqSqm241k6kcQ5UwttDILMK4BiurCfGEREw6+X9jkkpEe5T9FZaApyLGGOnFuyMWZpdolTXMtvEJ08Q==", + "license": "MIT", + "engines": { + "node": ">=18" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/content-type": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.5.tgz", + "integrity": "sha512-nTjqfcBFEipKdXCv4YDQWCfmcLZKm81ldF0pAopTvyrFGVbcR6P/VAAd5G7N+0tTr8QqiU0tFadD6FK4NtJwOA==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie": { + "version": "0.7.2", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.7.2.tgz", + "integrity": "sha512-yki5XnKuf750l50uGTllt6kKILY4nQ1eNIQatoXEByZ5dWgnKqbnqmTrBE5B4N7lrMJKQ2ytWMiTO2o0v6Ew/w==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie-signature": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.2.2.tgz", + "integrity": "sha512-D76uU73ulSXrD1UXF4KE2TMxVVwhsnCgfAyTg9k8P6KGZjlXKrOLe4dJQKI3Bxi5wjesZoFXJWElNWBjPZMbhg==", + "license": "MIT", + "engines": { + "node": ">=6.6.0" + } + }, + "node_modules/cors": { + "version": "2.8.6", + "resolved": "https://registry.npmjs.org/cors/-/cors-2.8.6.tgz", + "integrity": "sha512-tJtZBBHA6vjIAaF6EnIaq6laBBP9aq/Y3ouVJjEfoHbRBcHBAHYcMh/w8LDrk2PvIMMq8gmopa5D4V8RmbrxGw==", + "license": "MIT", + "dependencies": { + "object-assign": "^4", + "vary": "^1" + }, + "engines": { + "node": ">= 0.10" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/debug": { + "version": "4.4.3", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.3.tgz", + "integrity": "sha512-RGwwWnwQvkVfavKVt22FGLw+xYSdzARwm0ru6DhTVA3umU5hZc28V3kO4stgYryrTlLpuvgI9GiijltAjNbcqA==", + "license": "MIT", + "dependencies": { + "ms": "^2.1.3" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/decompress-response": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/decompress-response/-/decompress-response-6.0.0.tgz", + "integrity": "sha512-aW35yZM6Bb/4oJlZncMH2LCoZtJXTRxES17vE3hoRiowU2kWHaJKFkSBDnDR+cm9J+9QhXmREyIfv0pji9ejCQ==", + "license": "MIT", + "dependencies": { + "mimic-response": "^3.1.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/deep-extend": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/deep-extend/-/deep-extend-0.6.0.tgz", + "integrity": "sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==", + "license": "MIT", + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/depd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz", + "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/detect-libc": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-2.1.2.tgz", + "integrity": "sha512-Btj2BOOO83o3WyH59e8MgXsxEQVcarkUOpEYrubB0urwnN10yQ364rsiByU11nZlqWYZm05i/of7io4mzihBtQ==", + "license": "Apache-2.0", + "engines": { + "node": ">=8" + } + }, + "node_modules/dotenv": { + "version": "17.2.3", + "resolved": "https://registry.npmjs.org/dotenv/-/dotenv-17.2.3.tgz", + "integrity": "sha512-JVUnt+DUIzu87TABbhPmNfVdBDt18BLOWjMUFJMSi/Qqg7NTYtabbvSNJGOJ7afbRuv9D/lngizHtP7QyLQ+9w==", + "license": "BSD-2-Clause", + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://dotenvx.com" + } + }, + "node_modules/dunder-proto": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/dunder-proto/-/dunder-proto-1.0.1.tgz", + "integrity": "sha512-KIN/nDJBQRcXw0MLVhZE9iQHmG68qAVIBg9CqmUYjmQIhgij9U5MFvrqkUL5FbtyyzZuOeOt0zdeRe4UY7ct+A==", + "license": "MIT", + "dependencies": { + "call-bind-apply-helpers": "^1.0.1", + "es-errors": "^1.3.0", + "gopd": "^1.2.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==", + "license": "MIT" + }, + "node_modules/electron-to-chromium": { + "version": "1.5.279", + "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.5.279.tgz", + "integrity": "sha512-0bblUU5UNdOt5G7XqGiJtpZMONma6WAfq9vsFmtn9x1+joAObr6x1chfqyxFSDCAFwFhCQDrqeAr6MYdpwJ9Hg==", + "dev": true, + "license": "ISC" + }, + "node_modules/encodeurl": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-2.0.0.tgz", + "integrity": "sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/end-of-stream": { + "version": "1.4.5", + "resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.5.tgz", + "integrity": "sha512-ooEGc6HP26xXq/N+GCGOT0JKCLDGrq2bQUZrQ7gyrJiZANJ/8YDTxTpQBXGMn+WbIQXNVpyWymm7KYVICQnyOg==", + "license": "MIT", + "dependencies": { + "once": "^1.4.0" + } + }, + "node_modules/enhanced-resolve": { + "version": "5.18.4", + "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-5.18.4.tgz", + "integrity": "sha512-LgQMM4WXU3QI+SYgEc2liRgznaD5ojbmY3sb8LxyguVkIg5FxdpTkvk72te2R38/TGKxH634oLxXRGY6d7AP+Q==", + "dev": true, + "license": "MIT", + "dependencies": { + "graceful-fs": "^4.2.4", + "tapable": "^2.2.0" + }, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/entities": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/entities/-/entities-2.2.0.tgz", + "integrity": "sha512-p92if5Nz619I0w+akJrLZH0MX0Pb5DX39XOwQTtXSdQQOaYH03S1uIQp4mhOZtAXrxq4ViO67YTiLBo2638o9A==", + "license": "BSD-2-Clause", + "funding": { + "url": "https://github.com/fb55/entities?sponsor=1" + } + }, + "node_modules/es-define-property": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/es-define-property/-/es-define-property-1.0.1.tgz", + "integrity": "sha512-e3nRfgfUZ4rNGL232gUgX06QNyyez04KdjFrF+LTRoOXmrOgFKDg4BCdsjW8EnT69eqdYGmRpJwiPVYNrCaW3g==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-errors": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/es-errors/-/es-errors-1.3.0.tgz", + "integrity": "sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-object-atoms": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/es-object-atoms/-/es-object-atoms-1.1.1.tgz", + "integrity": "sha512-FGgH2h8zKNim9ljj7dankFPcICIK9Cp5bm+c2gQSYePhpaG5+esrLODihIorn+Pe6FGJzWhXQotPv73jTaldXA==", + "license": "MIT", + "dependencies": { + "es-errors": "^1.3.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/esbuild": { + "version": "0.27.2", + "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.27.2.tgz", + "integrity": "sha512-HyNQImnsOC7X9PMNaCIeAm4ISCQXs5a5YasTXVliKv4uuBo1dKrG0A+uQS8M5eXjVMnLg3WgXaKvprHlFJQffw==", + "dev": true, + "hasInstallScript": true, + "license": "MIT", + "bin": { + "esbuild": "bin/esbuild" + }, + "engines": { + "node": ">=18" + }, + "optionalDependencies": { + "@esbuild/aix-ppc64": "0.27.2", + "@esbuild/android-arm": "0.27.2", + "@esbuild/android-arm64": "0.27.2", + "@esbuild/android-x64": "0.27.2", + "@esbuild/darwin-arm64": "0.27.2", + "@esbuild/darwin-x64": "0.27.2", + "@esbuild/freebsd-arm64": "0.27.2", + "@esbuild/freebsd-x64": "0.27.2", + "@esbuild/linux-arm": "0.27.2", + "@esbuild/linux-arm64": "0.27.2", + "@esbuild/linux-ia32": "0.27.2", + "@esbuild/linux-loong64": "0.27.2", + "@esbuild/linux-mips64el": "0.27.2", + "@esbuild/linux-ppc64": "0.27.2", + "@esbuild/linux-riscv64": "0.27.2", + "@esbuild/linux-s390x": "0.27.2", + "@esbuild/linux-x64": "0.27.2", + "@esbuild/netbsd-arm64": "0.27.2", + "@esbuild/netbsd-x64": "0.27.2", + "@esbuild/openbsd-arm64": "0.27.2", + "@esbuild/openbsd-x64": "0.27.2", + "@esbuild/openharmony-arm64": "0.27.2", + "@esbuild/sunos-x64": "0.27.2", + "@esbuild/win32-arm64": "0.27.2", + "@esbuild/win32-ia32": "0.27.2", + "@esbuild/win32-x64": "0.27.2" + } + }, + "node_modules/escalade": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.2.0.tgz", + "integrity": "sha512-WUj2qlxaQtO4g6Pq5c29GTcWGDyd8itL8zTlipgECz3JesAiiOKotd8JU6otB3PACgG6xkJUyVhboMS+bje/jA==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=6" + } + }, + "node_modules/escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow==", + "license": "MIT" + }, + "node_modules/etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/expand-template": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/expand-template/-/expand-template-2.0.3.tgz", + "integrity": "sha512-XYfuKMvj4O35f/pOXLObndIRvyQ+/+6AhODh+OKWj9S9498pHHn/IMszH+gt0fBCRWMNfk1ZSp5x3AifmnI2vg==", + "license": "(MIT OR WTFPL)", + "engines": { + "node": ">=6" + } + }, + "node_modules/express": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/express/-/express-5.2.1.tgz", + "integrity": "sha512-hIS4idWWai69NezIdRt2xFVofaF4j+6INOpJlVOLDO8zXGpUVEVzIYk12UUi2JzjEzWL3IOAxcTubgz9Po0yXw==", + "license": "MIT", + "dependencies": { + "accepts": "^2.0.0", + "body-parser": "^2.2.1", + "content-disposition": "^1.0.0", + "content-type": "^1.0.5", + "cookie": "^0.7.1", + "cookie-signature": "^1.2.1", + "debug": "^4.4.0", + "depd": "^2.0.0", + "encodeurl": "^2.0.0", + "escape-html": "^1.0.3", + "etag": "^1.8.1", + "finalhandler": "^2.1.0", + "fresh": "^2.0.0", + "http-errors": "^2.0.0", + "merge-descriptors": "^2.0.0", + "mime-types": "^3.0.0", + "on-finished": "^2.4.1", + "once": "^1.4.0", + "parseurl": "^1.3.3", + "proxy-addr": "^2.0.7", + "qs": "^6.14.0", + "range-parser": "^1.2.1", + "router": "^2.2.0", + "send": "^1.1.0", + "serve-static": "^2.2.0", + "statuses": "^2.0.1", + "type-is": "^2.0.1", + "vary": "^1.1.2" + }, + "engines": { + "node": ">= 18" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/fdir": { + "version": "6.5.0", + "resolved": "https://registry.npmjs.org/fdir/-/fdir-6.5.0.tgz", + "integrity": "sha512-tIbYtZbucOs0BRGqPJkshJUYdL+SDH7dVM8gjy+ERp3WAUjLEFJE+02kanyHtwjWOnwrKYBiwAmM0p4kLJAnXg==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=12.0.0" + }, + "peerDependencies": { + "picomatch": "^3 || ^4" + }, + "peerDependenciesMeta": { + "picomatch": { + "optional": true + } + } + }, + "node_modules/file-uri-to-path": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/file-uri-to-path/-/file-uri-to-path-1.0.0.tgz", + "integrity": "sha512-0Zt+s3L7Vf1biwWZ29aARiVYLx7iMGnEUl9x33fbB/j3jR81u/O2LbqK+Bm1CDSNDKVtJ/YjwY7TUd5SkeLQLw==", + "license": "MIT" + }, + "node_modules/finalhandler": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-2.1.1.tgz", + "integrity": "sha512-S8KoZgRZN+a5rNwqTxlZZePjT/4cnm0ROV70LedRHZ0p8u9fRID0hJUZQpkKLzro8LfmC8sx23bY6tVNxv8pQA==", + "license": "MIT", + "dependencies": { + "debug": "^4.4.0", + "encodeurl": "^2.0.0", + "escape-html": "^1.0.3", + "on-finished": "^2.4.1", + "parseurl": "^1.3.3", + "statuses": "^2.0.1" + }, + "engines": { + "node": ">= 18.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/forwarded": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz", + "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/fraction.js": { + "version": "5.3.4", + "resolved": "https://registry.npmjs.org/fraction.js/-/fraction.js-5.3.4.tgz", + "integrity": "sha512-1X1NTtiJphryn/uLQz3whtY6jK3fTqoE3ohKs0tT+Ujr1W59oopxmoEh7Lu5p6vBaPbgoM0bzveAW4Qi5RyWDQ==", + "dev": true, + "license": "MIT", + "engines": { + "node": "*" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/rawify" + } + }, + "node_modules/fresh": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-2.0.0.tgz", + "integrity": "sha512-Rx/WycZ60HOaqLKAi6cHRKKI7zxWbJ31MhntmtwMoaTeF7XFH9hhBp8vITaMidfljRQ6eYWCKkaTK+ykVJHP2A==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/fs-constants": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs-constants/-/fs-constants-1.0.0.tgz", + "integrity": "sha512-y6OAwoSIf7FyjMIv94u+b5rdheZEjzR63GTyZJm5qh4Bi+2YgwLCcI/fPFZkL5PSixOt6ZNKm+w+Hfp/Bciwow==", + "license": "MIT" + }, + "node_modules/fsevents": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.3.tgz", + "integrity": "sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==", + "dev": true, + "hasInstallScript": true, + "license": "MIT", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": "^8.16.0 || ^10.6.0 || >=11.0.0" + } + }, + "node_modules/function-bind": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz", + "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==", + "license": "MIT", + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/get-intrinsic": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.3.0.tgz", + "integrity": "sha512-9fSjSaos/fRIVIp+xSJlE6lfwhES7LNtKaCBIamHsjr2na1BiABJPo0mOjjz8GJDURarmCPGqaiVg5mfjb98CQ==", + "license": "MIT", + "dependencies": { + "call-bind-apply-helpers": "^1.0.2", + "es-define-property": "^1.0.1", + "es-errors": "^1.3.0", + "es-object-atoms": "^1.1.1", + "function-bind": "^1.1.2", + "get-proto": "^1.0.1", + "gopd": "^1.2.0", + "has-symbols": "^1.1.0", + "hasown": "^2.0.2", + "math-intrinsics": "^1.1.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/get-proto": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/get-proto/-/get-proto-1.0.1.tgz", + "integrity": "sha512-sTSfBjoXBp89JvIKIefqw7U2CCebsc74kiY6awiGogKtoSGbgjYE/G/+l9sF3MWFPNc9IcoOC4ODfKHfxFmp0g==", + "license": "MIT", + "dependencies": { + "dunder-proto": "^1.0.1", + "es-object-atoms": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/github-from-package": { + "version": "0.0.0", + "resolved": "https://registry.npmjs.org/github-from-package/-/github-from-package-0.0.0.tgz", + "integrity": "sha512-SyHy3T1v2NUXn29OsWdxmK6RwHD+vkj3v8en8AOBZ1wBQ/hCAQ5bAQTD02kW4W9tUp/3Qh6J8r9EvntiyCmOOw==", + "license": "MIT" + }, + "node_modules/gopd": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.2.0.tgz", + "integrity": "sha512-ZUKRh6/kUFoAiTAtTYPZJ3hw9wNxx+BIBOijnlG9PnrJsCcSjs1wyyD6vJpaYtgnzDrKYRSqf3OO6Rfa93xsRg==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/graceful-fs": { + "version": "4.2.11", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.11.tgz", + "integrity": "sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ==", + "dev": true, + "license": "ISC" + }, + "node_modules/has-symbols": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.1.0.tgz", + "integrity": "sha512-1cDNdwJ2Jaohmb3sg4OmKaMBwuC48sYni5HUw2DvsC8LjGTLK9h+eb1X6RyuOHe4hT0ULCW68iomhjUoKUqlPQ==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/hasown": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz", + "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==", + "license": "MIT", + "dependencies": { + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/http-errors": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.1.tgz", + "integrity": "sha512-4FbRdAX+bSdmo4AUFuS0WNiPz8NgFt+r8ThgNWmlrjQjt1Q7ZR9+zTlce2859x4KSXrwIsaeTqDoKQmtP8pLmQ==", + "license": "MIT", + "dependencies": { + "depd": "~2.0.0", + "inherits": "~2.0.4", + "setprototypeof": "~1.2.0", + "statuses": "~2.0.2", + "toidentifier": "~1.0.1" + }, + "engines": { + "node": ">= 0.8" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/iconv-lite": { + "version": "0.7.2", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.7.2.tgz", + "integrity": "sha512-im9DjEDQ55s9fL4EYzOAv0yMqmMBSZp6G0VvFyTMPKWxiSBHUj9NW/qqLmXUwXrrM7AvqSlTCfvqRb0cM8yYqw==", + "license": "MIT", + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3.0.0" + }, + "engines": { + "node": ">=0.10.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/ieee754": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.2.1.tgz", + "integrity": "sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "BSD-3-Clause" + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", + "license": "ISC" + }, + "node_modules/ini": { + "version": "1.3.8", + "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.8.tgz", + "integrity": "sha512-JV/yugV2uzW5iMRSiZAyDtQd+nxtUnjeLt0acNdw98kKLrvuRVyB80tsREOE7yvGVgalhZ6RNXCmEHkUKBKxew==", + "license": "ISC" + }, + "node_modules/ipaddr.js": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz", + "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==", + "license": "MIT", + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/is-promise": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/is-promise/-/is-promise-4.0.0.tgz", + "integrity": "sha512-hvpoI6korhJMnej285dSg6nu1+e6uxs7zG3BYAm5byqDsgJNWwxzM6z6iZiAgQR4TJ30JmBTOwqZUw3WlyH3AQ==", + "license": "MIT" + }, + "node_modules/jiti": { + "version": "2.6.1", + "resolved": "https://registry.npmjs.org/jiti/-/jiti-2.6.1.tgz", + "integrity": "sha512-ekilCSN1jwRvIbgeg/57YFh8qQDNbwDb9xT/qu2DAHbFFZUicIl4ygVaAvzveMhMVr3LnpSKTNnwt8PoOfmKhQ==", + "dev": true, + "license": "MIT", + "bin": { + "jiti": "lib/jiti-cli.mjs" + } + }, + "node_modules/lightningcss": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss/-/lightningcss-1.30.2.tgz", + "integrity": "sha512-utfs7Pr5uJyyvDETitgsaqSyjCb2qNRAtuqUeWIAKztsOYdcACf2KtARYXg2pSvhkt+9NfoaNY7fxjl6nuMjIQ==", + "dev": true, + "license": "MPL-2.0", + "dependencies": { + "detect-libc": "^2.0.3" + }, + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + }, + "optionalDependencies": { + "lightningcss-android-arm64": "1.30.2", + "lightningcss-darwin-arm64": "1.30.2", + "lightningcss-darwin-x64": "1.30.2", + "lightningcss-freebsd-x64": "1.30.2", + "lightningcss-linux-arm-gnueabihf": "1.30.2", + "lightningcss-linux-arm64-gnu": "1.30.2", + "lightningcss-linux-arm64-musl": "1.30.2", + "lightningcss-linux-x64-gnu": "1.30.2", + "lightningcss-linux-x64-musl": "1.30.2", + "lightningcss-win32-arm64-msvc": "1.30.2", + "lightningcss-win32-x64-msvc": "1.30.2" + } + }, + "node_modules/lightningcss-android-arm64": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-android-arm64/-/lightningcss-android-arm64-1.30.2.tgz", + "integrity": "sha512-BH9sEdOCahSgmkVhBLeU7Hc9DWeZ1Eb6wNS6Da8igvUwAe0sqROHddIlvU06q3WyXVEOYDZ6ykBZQnjTbmo4+A==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-darwin-arm64": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-darwin-arm64/-/lightningcss-darwin-arm64-1.30.2.tgz", + "integrity": "sha512-ylTcDJBN3Hp21TdhRT5zBOIi73P6/W0qwvlFEk22fkdXchtNTOU4Qc37SkzV+EKYxLouZ6M4LG9NfZ1qkhhBWA==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-darwin-x64": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-darwin-x64/-/lightningcss-darwin-x64-1.30.2.tgz", + "integrity": "sha512-oBZgKchomuDYxr7ilwLcyms6BCyLn0z8J0+ZZmfpjwg9fRVZIR5/GMXd7r9RH94iDhld3UmSjBM6nXWM2TfZTQ==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-freebsd-x64": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-freebsd-x64/-/lightningcss-freebsd-x64-1.30.2.tgz", + "integrity": "sha512-c2bH6xTrf4BDpK8MoGG4Bd6zAMZDAXS569UxCAGcA7IKbHNMlhGQ89eRmvpIUGfKWNVdbhSbkQaWhEoMGmGslA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm-gnueabihf": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm-gnueabihf/-/lightningcss-linux-arm-gnueabihf-1.30.2.tgz", + "integrity": "sha512-eVdpxh4wYcm0PofJIZVuYuLiqBIakQ9uFZmipf6LF/HRj5Bgm0eb3qL/mr1smyXIS1twwOxNWndd8z0E374hiA==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm64-gnu": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm64-gnu/-/lightningcss-linux-arm64-gnu-1.30.2.tgz", + "integrity": "sha512-UK65WJAbwIJbiBFXpxrbTNArtfuznvxAJw4Q2ZGlU8kPeDIWEX1dg3rn2veBVUylA2Ezg89ktszWbaQnxD/e3A==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm64-musl": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm64-musl/-/lightningcss-linux-arm64-musl-1.30.2.tgz", + "integrity": "sha512-5Vh9dGeblpTxWHpOx8iauV02popZDsCYMPIgiuw97OJ5uaDsL86cnqSFs5LZkG3ghHoX5isLgWzMs+eD1YzrnA==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-x64-gnu": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-x64-gnu/-/lightningcss-linux-x64-gnu-1.30.2.tgz", + "integrity": "sha512-Cfd46gdmj1vQ+lR6VRTTadNHu6ALuw2pKR9lYq4FnhvgBc4zWY1EtZcAc6EffShbb1MFrIPfLDXD6Xprbnni4w==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-x64-musl": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-x64-musl/-/lightningcss-linux-x64-musl-1.30.2.tgz", + "integrity": "sha512-XJaLUUFXb6/QG2lGIW6aIk6jKdtjtcffUT0NKvIqhSBY3hh9Ch+1LCeH80dR9q9LBjG3ewbDjnumefsLsP6aiA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-win32-arm64-msvc": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-win32-arm64-msvc/-/lightningcss-win32-arm64-msvc-1.30.2.tgz", + "integrity": "sha512-FZn+vaj7zLv//D/192WFFVA0RgHawIcHqLX9xuWiQt7P0PtdFEVaxgF9rjM/IRYHQXNnk61/H/gb2Ei+kUQ4xQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-win32-x64-msvc": { + "version": "1.30.2", + "resolved": "https://registry.npmjs.org/lightningcss-win32-x64-msvc/-/lightningcss-win32-x64-msvc-1.30.2.tgz", + "integrity": "sha512-5g1yc73p+iAkid5phb4oVFMB45417DkRevRbt/El/gKXJk4jid+vPFF/AXbxn05Aky8PapwzZrdJShv5C0avjw==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/magic-string": { + "version": "0.30.21", + "resolved": "https://registry.npmjs.org/magic-string/-/magic-string-0.30.21.tgz", + "integrity": "sha512-vd2F4YUyEXKGcLHoq+TEyCjxueSeHnFxyyjNp80yg0XV4vUhnDer/lvvlqM/arB5bXQN5K2/3oinyCRyx8T2CQ==", + "dev": true, + "license": "MIT", + "dependencies": { + "@jridgewell/sourcemap-codec": "^1.5.5" + } + }, + "node_modules/math-intrinsics": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/math-intrinsics/-/math-intrinsics-1.1.0.tgz", + "integrity": "sha512-/IXtbwEk5HTPyEwyKX6hGkYXxM9nbj64B+ilVJnC/R6B0pH5G4V3b0pVbL7DBj4tkhBAppbQUlf6F6Xl9LHu1g==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/media-typer": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-1.1.0.tgz", + "integrity": "sha512-aisnrDP4GNe06UcKFnV5bfMNPBUw4jsLGaWwWfnH3v02GnBuXX2MCVn5RbrWo0j3pczUilYblq7fQ7Nw2t5XKw==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/merge-descriptors": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-2.0.0.tgz", + "integrity": "sha512-Snk314V5ayFLhp3fkUREub6WtjBfPdCPY1Ln8/8munuLuiYhsABgBVWsozAG+MWMbVEvcdcpbi9R7ww22l9Q3g==", + "license": "MIT", + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/mime-db": { + "version": "1.54.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.54.0.tgz", + "integrity": "sha512-aU5EJuIN2WDemCcAp2vFBfp/m4EAhWJnUNSSw0ixs7/kXbd6Pg64EmwJkNdFhB8aWt1sH2CTXrLxo/iAGV3oPQ==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-3.0.2.tgz", + "integrity": "sha512-Lbgzdk0h4juoQ9fCKXW4by0UJqj+nOOrI9MJ1sSj4nI8aI2eo1qmvQEie4VD1glsS250n15LsWsYtCugiStS5A==", + "license": "MIT", + "dependencies": { + "mime-db": "^1.54.0" + }, + "engines": { + "node": ">=18" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/mimic-response": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/mimic-response/-/mimic-response-3.1.0.tgz", + "integrity": "sha512-z0yWI+4FDrrweS8Zmt4Ej5HdJmky15+L2e6Wgn3+iK5fWzb6T3fhNFq2+MeTRb064c6Wr4N/wv0DzQTjNzHNGQ==", + "license": "MIT", + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/minimist": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.8.tgz", + "integrity": "sha512-2yyAR8qBkN3YuheJanUpWC5U3bb5osDywNB8RzDVlDwDHbocAJveqqj1u8+SVD7jkWT4yvsHCpWqqWqAxb0zCA==", + "license": "MIT", + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/mkdirp-classic": { + "version": "0.5.3", + "resolved": "https://registry.npmjs.org/mkdirp-classic/-/mkdirp-classic-0.5.3.tgz", + "integrity": "sha512-gKLcREMhtuZRwRAfqP3RFW+TK4JqApVBtOIftVgjuABpAtpxhPGaDcfvbhNvD0B8iD1oUr/txX35NjcaY6Ns/A==", + "license": "MIT" + }, + "node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "license": "MIT" + }, + "node_modules/nanoid": { + "version": "3.3.11", + "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.11.tgz", + "integrity": "sha512-N8SpfPUnUp1bK+PMYW8qSWdl9U+wwNWI4QKxOYDy9JAro3WMX7p2OeVRF9v+347pnakNevPmiHhNmZ2HbFA76w==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "license": "MIT", + "bin": { + "nanoid": "bin/nanoid.cjs" + }, + "engines": { + "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1" + } + }, + "node_modules/napi-build-utils": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/napi-build-utils/-/napi-build-utils-2.0.0.tgz", + "integrity": "sha512-GEbrYkbfF7MoNaoh2iGG84Mnf/WZfB0GdGEsM8wz7Expx/LlWf5U8t9nvJKXSp3qr5IsEbK04cBGhol/KwOsWA==", + "license": "MIT" + }, + "node_modules/negotiator": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-1.0.0.tgz", + "integrity": "sha512-8Ofs/AUQh8MaEcrlq5xOX0CQ9ypTF5dl78mjlMNfOK08fzpgTHQRQPBxcPlEtIw0yRpws+Zo/3r+5WRby7u3Gg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/node-abi": { + "version": "3.87.0", + "resolved": "https://registry.npmjs.org/node-abi/-/node-abi-3.87.0.tgz", + "integrity": "sha512-+CGM1L1CgmtheLcBuleyYOn7NWPVu0s0EJH2C4puxgEZb9h8QpR9G2dBfZJOAUhi7VQxuBPMd0hiISWcTyiYyQ==", + "license": "MIT", + "dependencies": { + "semver": "^7.3.5" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/node-releases": { + "version": "2.0.27", + "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-2.0.27.tgz", + "integrity": "sha512-nmh3lCkYZ3grZvqcCH+fjmQ7X+H0OeZgP40OierEaAptX4XofMh5kwNbWh7lBduUzCcV/8kZ+NDLCwm2iorIlA==", + "dev": true, + "license": "MIT" + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==", + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-inspect": { + "version": "1.13.4", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.4.tgz", + "integrity": "sha512-W67iLl4J2EXEGTbfeHCffrjDfitvLANg0UlX3wFUUSTx92KXRFegMHUVgSqE+wvhAbi4WqjGg9czysTV2Epbew==", + "license": "MIT", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/on-finished": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz", + "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==", + "license": "MIT", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/once": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", + "integrity": "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w==", + "license": "ISC", + "dependencies": { + "wrappy": "1" + } + }, + "node_modules/openai": { + "version": "6.16.0", + "resolved": "https://registry.npmjs.org/openai/-/openai-6.16.0.tgz", + "integrity": "sha512-fZ1uBqjFUjXzbGc35fFtYKEOxd20kd9fDpFeqWtsOZWiubY8CZ1NAlXHW3iathaFvqmNtCWMIsosCuyeI7Joxg==", + "license": "Apache-2.0", + "bin": { + "openai": "bin/cli" + }, + "peerDependencies": { + "ws": "^8.18.0", + "zod": "^3.25 || ^4.0" + }, + "peerDependenciesMeta": { + "ws": { + "optional": true + }, + "zod": { + "optional": true + } + } + }, + "node_modules/parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/path-to-regexp": { + "version": "8.3.0", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-8.3.0.tgz", + "integrity": "sha512-7jdwVIRtsP8MYpdXSwOS0YdD0Du+qOoF/AEPIt88PcCFrZCzx41oxku1jD88hZBwbNUIEfpqvuhjFaMAqMTWnA==", + "license": "MIT", + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/picocolors": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.1.1.tgz", + "integrity": "sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==", + "dev": true, + "license": "ISC" + }, + "node_modules/picomatch": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-4.0.3.tgz", + "integrity": "sha512-5gTmgEY/sqK6gFXLIsQNH19lWb4ebPDLA4SdLP7dsWkIXHWlG66oPuVvXSGFPppYZz8ZDZq0dYYrbHfBCVUb1Q==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/sponsors/jonschlinkert" + } + }, + "node_modules/postcss": { + "version": "8.5.6", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.5.6.tgz", + "integrity": "sha512-3Ybi1tAuwAP9s0r1UQ2J4n5Y0G05bJkpUIO0/bI9MhwmD70S5aTWbXGBwxHrelT+XM1k6dM0pk+SwNkpTRN7Pg==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/postcss" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "license": "MIT", + "dependencies": { + "nanoid": "^3.3.11", + "picocolors": "^1.1.1", + "source-map-js": "^1.2.1" + }, + "engines": { + "node": "^10 || ^12 || >=14" + } + }, + "node_modules/postcss-value-parser": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-4.2.0.tgz", + "integrity": "sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==", + "dev": true, + "license": "MIT" + }, + "node_modules/prebuild-install": { + "version": "7.1.3", + "resolved": "https://registry.npmjs.org/prebuild-install/-/prebuild-install-7.1.3.tgz", + "integrity": "sha512-8Mf2cbV7x1cXPUILADGI3wuhfqWvtiLA1iclTDbFRZkgRQS0NqsPZphna9V+HyTEadheuPmjaJMsbzKQFOzLug==", + "license": "MIT", + "dependencies": { + "detect-libc": "^2.0.0", + "expand-template": "^2.0.3", + "github-from-package": "0.0.0", + "minimist": "^1.2.3", + "mkdirp-classic": "^0.5.3", + "napi-build-utils": "^2.0.0", + "node-abi": "^3.3.0", + "pump": "^3.0.0", + "rc": "^1.2.7", + "simple-get": "^4.0.0", + "tar-fs": "^2.0.0", + "tunnel-agent": "^0.6.0" + }, + "bin": { + "prebuild-install": "bin.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/proxy-addr": { + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz", + "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==", + "license": "MIT", + "dependencies": { + "forwarded": "0.2.0", + "ipaddr.js": "1.9.1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/pump": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.3.tgz", + "integrity": "sha512-todwxLMY7/heScKmntwQG8CXVkWUOdYxIvY2s0VWAAMh/nd8SoYiRaKjlr7+iCs984f2P8zvrfWcDDYVb73NfA==", + "license": "MIT", + "dependencies": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + }, + "node_modules/qs": { + "version": "6.14.1", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.14.1.tgz", + "integrity": "sha512-4EK3+xJl8Ts67nLYNwqw/dsFVnCf+qR7RgXSK9jEEm9unao3njwMDdmsdvoKBKHzxd7tCYz5e5M+SnMjdtXGQQ==", + "license": "BSD-3-Clause", + "dependencies": { + "side-channel": "^1.1.0" + }, + "engines": { + "node": ">=0.6" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/raw-body": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-3.0.2.tgz", + "integrity": "sha512-K5zQjDllxWkf7Z5xJdV0/B0WTNqx6vxG70zJE4N0kBs4LovmEYWJzQGxC9bS9RAKu3bgM40lrd5zoLJ12MQ5BA==", + "license": "MIT", + "dependencies": { + "bytes": "~3.1.2", + "http-errors": "~2.0.1", + "iconv-lite": "~0.7.0", + "unpipe": "~1.0.0" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/rc": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/rc/-/rc-1.2.8.tgz", + "integrity": "sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==", + "license": "(BSD-2-Clause OR MIT OR Apache-2.0)", + "dependencies": { + "deep-extend": "^0.6.0", + "ini": "~1.3.0", + "minimist": "^1.2.0", + "strip-json-comments": "~2.0.1" + }, + "bin": { + "rc": "cli.js" + } + }, + "node_modules/readable-stream": { + "version": "3.6.2", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.2.tgz", + "integrity": "sha512-9u/sniCrY3D5WdsERHzHE4G2YCXqoG5FTHUiCC4SIbr6XcLZBY05ya9EKjYek9O5xOAwjGq+1JdGBAS7Q9ScoA==", + "license": "MIT", + "dependencies": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/rollup": { + "version": "4.56.0", + "resolved": "https://registry.npmjs.org/rollup/-/rollup-4.56.0.tgz", + "integrity": "sha512-9FwVqlgUHzbXtDg9RCMgodF3Ua4Na6Gau+Sdt9vyCN4RhHfVKX2DCHy3BjMLTDd47ITDhYAnTwGulWTblJSDLg==", + "dev": true, + "license": "MIT", + "dependencies": { + "@types/estree": "1.0.8" + }, + "bin": { + "rollup": "dist/bin/rollup" + }, + "engines": { + "node": ">=18.0.0", + "npm": ">=8.0.0" + }, + "optionalDependencies": { + "@rollup/rollup-android-arm-eabi": "4.56.0", + "@rollup/rollup-android-arm64": "4.56.0", + "@rollup/rollup-darwin-arm64": "4.56.0", + "@rollup/rollup-darwin-x64": "4.56.0", + "@rollup/rollup-freebsd-arm64": "4.56.0", + "@rollup/rollup-freebsd-x64": "4.56.0", + "@rollup/rollup-linux-arm-gnueabihf": "4.56.0", + "@rollup/rollup-linux-arm-musleabihf": "4.56.0", + "@rollup/rollup-linux-arm64-gnu": "4.56.0", + "@rollup/rollup-linux-arm64-musl": "4.56.0", + "@rollup/rollup-linux-loong64-gnu": "4.56.0", + "@rollup/rollup-linux-loong64-musl": "4.56.0", + "@rollup/rollup-linux-ppc64-gnu": "4.56.0", + "@rollup/rollup-linux-ppc64-musl": "4.56.0", + "@rollup/rollup-linux-riscv64-gnu": "4.56.0", + "@rollup/rollup-linux-riscv64-musl": "4.56.0", + "@rollup/rollup-linux-s390x-gnu": "4.56.0", + "@rollup/rollup-linux-x64-gnu": "4.56.0", + "@rollup/rollup-linux-x64-musl": "4.56.0", + "@rollup/rollup-openbsd-x64": "4.56.0", + "@rollup/rollup-openharmony-arm64": "4.56.0", + "@rollup/rollup-win32-arm64-msvc": "4.56.0", + "@rollup/rollup-win32-ia32-msvc": "4.56.0", + "@rollup/rollup-win32-x64-gnu": "4.56.0", + "@rollup/rollup-win32-x64-msvc": "4.56.0", + "fsevents": "~2.3.2" + } + }, + "node_modules/router": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/router/-/router-2.2.0.tgz", + "integrity": "sha512-nLTrUKm2UyiL7rlhapu/Zl45FwNgkZGaCpZbIHajDYgwlJCOzLSk+cIPAnsEqV955GjILJnKbdQC1nVPz+gAYQ==", + "license": "MIT", + "dependencies": { + "debug": "^4.4.0", + "depd": "^2.0.0", + "is-promise": "^4.0.0", + "parseurl": "^1.3.3", + "path-to-regexp": "^8.0.0" + }, + "engines": { + "node": ">= 18" + } + }, + "node_modules/rss-parser": { + "version": "3.13.0", + "resolved": "https://registry.npmjs.org/rss-parser/-/rss-parser-3.13.0.tgz", + "integrity": "sha512-7jWUBV5yGN3rqMMj7CZufl/291QAhvrrGpDNE4k/02ZchL0npisiYYqULF71jCEKoIiHvK/Q2e6IkDwPziT7+w==", + "license": "MIT", + "dependencies": { + "entities": "^2.0.3", + "xml2js": "^0.5.0" + } + }, + "node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "MIT" + }, + "node_modules/safer-buffer": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==", + "license": "MIT" + }, + "node_modules/sax": { + "version": "1.4.4", + "resolved": "https://registry.npmjs.org/sax/-/sax-1.4.4.tgz", + "integrity": "sha512-1n3r/tGXO6b6VXMdFT54SHzT9ytu9yr7TaELowdYpMqY/Ao7EnlQGmAQ1+RatX7Tkkdm6hONI2owqNx2aZj5Sw==", + "license": "BlueOak-1.0.0", + "engines": { + "node": ">=11.0.0" + } + }, + "node_modules/semver": { + "version": "7.7.3", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.7.3.tgz", + "integrity": "sha512-SdsKMrI9TdgjdweUSR9MweHA4EJ8YxHn8DFaDisvhVlUOe4BF1tLD7GAj0lIqWVl+dPb/rExr0Btby5loQm20Q==", + "license": "ISC", + "bin": { + "semver": "bin/semver.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/send": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/send/-/send-1.2.1.tgz", + "integrity": "sha512-1gnZf7DFcoIcajTjTwjwuDjzuz4PPcY2StKPlsGAQ1+YH20IRVrBaXSWmdjowTJ6u8Rc01PoYOGHXfP1mYcZNQ==", + "license": "MIT", + "dependencies": { + "debug": "^4.4.3", + "encodeurl": "^2.0.0", + "escape-html": "^1.0.3", + "etag": "^1.8.1", + "fresh": "^2.0.0", + "http-errors": "^2.0.1", + "mime-types": "^3.0.2", + "ms": "^2.1.3", + "on-finished": "^2.4.1", + "range-parser": "^1.2.1", + "statuses": "^2.0.2" + }, + "engines": { + "node": ">= 18" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/serve-static": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-2.2.1.tgz", + "integrity": "sha512-xRXBn0pPqQTVQiC8wyQrKs2MOlX24zQ0POGaj0kultvoOCstBQM5yvOhAVSUwOMjQtTvsPWoNCHfPGwaaQJhTw==", + "license": "MIT", + "dependencies": { + "encodeurl": "^2.0.0", + "escape-html": "^1.0.3", + "parseurl": "^1.3.3", + "send": "^1.2.0" + }, + "engines": { + "node": ">= 18" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/express" + } + }, + "node_modules/setprototypeof": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz", + "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==", + "license": "ISC" + }, + "node_modules/side-channel": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.1.0.tgz", + "integrity": "sha512-ZX99e6tRweoUXqR+VBrslhda51Nh5MTQwou5tnUDgbtyM0dBgmhEDtWGP/xbKn6hqfPRHujUNwz5fy/wbbhnpw==", + "license": "MIT", + "dependencies": { + "es-errors": "^1.3.0", + "object-inspect": "^1.13.3", + "side-channel-list": "^1.0.0", + "side-channel-map": "^1.0.1", + "side-channel-weakmap": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/side-channel-list": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/side-channel-list/-/side-channel-list-1.0.0.tgz", + "integrity": "sha512-FCLHtRD/gnpCiCHEiJLOwdmFP+wzCmDEkc9y7NsYxeF4u7Btsn1ZuwgwJGxImImHicJArLP4R0yX4c2KCrMrTA==", + "license": "MIT", + "dependencies": { + "es-errors": "^1.3.0", + "object-inspect": "^1.13.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/side-channel-map": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/side-channel-map/-/side-channel-map-1.0.1.tgz", + "integrity": "sha512-VCjCNfgMsby3tTdo02nbjtM/ewra6jPHmpThenkTYh8pG9ucZ/1P8So4u4FGBek/BjpOVsDCMoLA/iuBKIFXRA==", + "license": "MIT", + "dependencies": { + "call-bound": "^1.0.2", + "es-errors": "^1.3.0", + "get-intrinsic": "^1.2.5", + "object-inspect": "^1.13.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/side-channel-weakmap": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/side-channel-weakmap/-/side-channel-weakmap-1.0.2.tgz", + "integrity": "sha512-WPS/HvHQTYnHisLo9McqBHOJk2FkHO/tlpvldyrnem4aeQp4hai3gythswg6p01oSoTl58rcpiFAjF2br2Ak2A==", + "license": "MIT", + "dependencies": { + "call-bound": "^1.0.2", + "es-errors": "^1.3.0", + "get-intrinsic": "^1.2.5", + "object-inspect": "^1.13.3", + "side-channel-map": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/simple-concat": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/simple-concat/-/simple-concat-1.0.1.tgz", + "integrity": "sha512-cSFtAPtRhljv69IK0hTVZQ+OfE9nePi/rtJmw5UjHeVyVroEqJXP1sFztKUy1qU+xvz3u/sfYJLa947b7nAN2Q==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "MIT" + }, + "node_modules/simple-get": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/simple-get/-/simple-get-4.0.1.tgz", + "integrity": "sha512-brv7p5WgH0jmQJr1ZDDfKDOSeWWg+OVypG99A/5vYGPqJ6pxiaHLy8nxtFjBA7oMa01ebA9gfh1uMCFqOuXxvA==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "MIT", + "dependencies": { + "decompress-response": "^6.0.0", + "once": "^1.3.1", + "simple-concat": "^1.0.0" + } + }, + "node_modules/source-map-js": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.2.1.tgz", + "integrity": "sha512-UXWMKhLOwVKb728IUtQPXxfYU+usdybtUrK/8uGE8CQMvrhOpwvzDBwj0QhSL7MQc7vIsISBG8VQ8+IDQxpfQA==", + "dev": true, + "license": "BSD-3-Clause", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/statuses": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.2.tgz", + "integrity": "sha512-DvEy55V3DB7uknRo+4iOGT5fP1slR8wQohVdknigZPMpMstaKJQWhwiYBACJE3Ul2pTnATihhBYnRhZQHGBiRw==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/string_decoder": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.3.0.tgz", + "integrity": "sha512-hkRX8U1WjJFd8LsDJ2yQ/wWWxaopEsABU1XfkM8A+j0+85JAGppt16cr1Whg6KIbb4okU6Mql6BOj+uup/wKeA==", + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.2.0" + } + }, + "node_modules/strip-json-comments": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-2.0.1.tgz", + "integrity": "sha512-4gB8na07fecVVkOI6Rs4e7T6NOTki5EmL7TUduTs6bu3EdnSycntVJ4re8kgZA+wx9IueI2Y11bfbgwtzuE0KQ==", + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/tailwindcss": { + "version": "4.1.18", + "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-4.1.18.tgz", + "integrity": "sha512-4+Z+0yiYyEtUVCScyfHCxOYP06L5Ne+JiHhY2IjR2KWMIWhJOYZKLSGZaP5HkZ8+bY0cxfzwDE5uOmzFXyIwxw==", + "dev": true, + "license": "MIT" + }, + "node_modules/tapable": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/tapable/-/tapable-2.3.0.tgz", + "integrity": "sha512-g9ljZiwki/LfxmQADO3dEY1CbpmXT5Hm2fJ+QaGKwSXUylMybePR7/67YW7jOrrvjEgL1Fmz5kzyAjWVWLlucg==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=6" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/webpack" + } + }, + "node_modules/tar-fs": { + "version": "2.1.4", + "resolved": "https://registry.npmjs.org/tar-fs/-/tar-fs-2.1.4.tgz", + "integrity": "sha512-mDAjwmZdh7LTT6pNleZ05Yt65HC3E+NiQzl672vQG38jIrehtJk/J3mNwIg+vShQPcLF/LV7CMnDW6vjj6sfYQ==", + "license": "MIT", + "dependencies": { + "chownr": "^1.1.1", + "mkdirp-classic": "^0.5.2", + "pump": "^3.0.0", + "tar-stream": "^2.1.4" + } + }, + "node_modules/tar-stream": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/tar-stream/-/tar-stream-2.2.0.tgz", + "integrity": "sha512-ujeqbceABgwMZxEJnk2HDY2DlnUZ+9oEcb1KzTVfYHio0UE6dG71n60d8D2I4qNvleWrrXpmjpt7vZeF1LnMZQ==", + "license": "MIT", + "dependencies": { + "bl": "^4.0.3", + "end-of-stream": "^1.4.1", + "fs-constants": "^1.0.0", + "inherits": "^2.0.3", + "readable-stream": "^3.1.1" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/tinyglobby": { + "version": "0.2.15", + "resolved": "https://registry.npmjs.org/tinyglobby/-/tinyglobby-0.2.15.tgz", + "integrity": "sha512-j2Zq4NyQYG5XMST4cbs02Ak8iJUdxRM0XI5QyxXuZOzKOINmWurp3smXu3y5wDcJrptwpSjgXHzIQxR0omXljQ==", + "dev": true, + "license": "MIT", + "dependencies": { + "fdir": "^6.5.0", + "picomatch": "^4.0.3" + }, + "engines": { + "node": ">=12.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/SuperchupuDev" + } + }, + "node_modules/toidentifier": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz", + "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==", + "license": "MIT", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/tunnel-agent": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.6.0.tgz", + "integrity": "sha512-McnNiV1l8RYeY8tBgEpuodCC1mLUdbSN+CYBL7kJsJNInOP8UjDDEwdk6Mw60vdLLrr5NHKZhMAOSrR2NZuQ+w==", + "license": "Apache-2.0", + "dependencies": { + "safe-buffer": "^5.0.1" + }, + "engines": { + "node": "*" + } + }, + "node_modules/type-is": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-2.0.1.tgz", + "integrity": "sha512-OZs6gsjF4vMp32qrCbiVSkrFmXtG/AZhY3t0iAMrMBiAZyV9oALtXO8hsrHbMXF9x6L3grlFuwW2oAz7cav+Gw==", + "license": "MIT", + "dependencies": { + "content-type": "^1.0.5", + "media-typer": "^1.1.0", + "mime-types": "^3.0.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/update-browserslist-db": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/update-browserslist-db/-/update-browserslist-db-1.2.3.tgz", + "integrity": "sha512-Js0m9cx+qOgDxo0eMiFGEueWztz+d4+M3rGlmKPT+T4IS/jP4ylw3Nwpu6cpTTP8R1MAC1kF4VbdLt3ARf209w==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "license": "MIT", + "dependencies": { + "escalade": "^3.2.0", + "picocolors": "^1.1.1" + }, + "bin": { + "update-browserslist-db": "cli.js" + }, + "peerDependencies": { + "browserslist": ">= 4.21.0" + } + }, + "node_modules/util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==", + "license": "MIT" + }, + "node_modules/vary": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "integrity": "sha512-BNGbWLfd0eUPabhkXUVm0j8uuvREyTh5ovRa/dyow/BqAbZJyC+5fU+IzQOzmAKzYqYRAISoRhdQr3eIZ/PXqg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/vite": { + "version": "7.3.1", + "resolved": "https://registry.npmjs.org/vite/-/vite-7.3.1.tgz", + "integrity": "sha512-w+N7Hifpc3gRjZ63vYBXA56dvvRlNWRczTdmCBBa+CotUzAPf5b7YMdMR/8CQoeYE5LX3W4wj6RYTgonm1b9DA==", + "dev": true, + "license": "MIT", + "dependencies": { + "esbuild": "^0.27.0", + "fdir": "^6.5.0", + "picomatch": "^4.0.3", + "postcss": "^8.5.6", + "rollup": "^4.43.0", + "tinyglobby": "^0.2.15" + }, + "bin": { + "vite": "bin/vite.js" + }, + "engines": { + "node": "^20.19.0 || >=22.12.0" + }, + "funding": { + "url": "https://github.com/vitejs/vite?sponsor=1" + }, + "optionalDependencies": { + "fsevents": "~2.3.3" + }, + "peerDependencies": { + "@types/node": "^20.19.0 || >=22.12.0", + "jiti": ">=1.21.0", + "less": "^4.0.0", + "lightningcss": "^1.21.0", + "sass": "^1.70.0", + "sass-embedded": "^1.70.0", + "stylus": ">=0.54.8", + "sugarss": "^5.0.0", + "terser": "^5.16.0", + "tsx": "^4.8.1", + "yaml": "^2.4.2" + }, + "peerDependenciesMeta": { + "@types/node": { + "optional": true + }, + "jiti": { + "optional": true + }, + "less": { + "optional": true + }, + "lightningcss": { + "optional": true + }, + "sass": { + "optional": true + }, + "sass-embedded": { + "optional": true + }, + "stylus": { + "optional": true + }, + "sugarss": { + "optional": true + }, + "terser": { + "optional": true + }, + "tsx": { + "optional": true + }, + "yaml": { + "optional": true + } + } + }, + "node_modules/wrappy": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", + "integrity": "sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ==", + "license": "ISC" + }, + "node_modules/xml2js": { + "version": "0.5.0", + "resolved": "https://registry.npmjs.org/xml2js/-/xml2js-0.5.0.tgz", + "integrity": "sha512-drPFnkQJik/O+uPKpqSgr22mpuFHqKdbS835iAQrUC73L2F5WkboIRd63ai/2Yg6I1jzifPFKH2NTK+cfglkIA==", + "license": "MIT", + "dependencies": { + "sax": ">=0.6.0", + "xmlbuilder": "~11.0.0" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/xmlbuilder": { + "version": "11.0.1", + "resolved": "https://registry.npmjs.org/xmlbuilder/-/xmlbuilder-11.0.1.tgz", + "integrity": "sha512-fDlsI/kFEx7gLvbecc0/ohLG50fugQp8ryHzMTuW9vSa1GJ0XYWKnhsUx7oie3G98+r56aTQIUB4kht42R3JvA==", + "license": "MIT", + "engines": { + "node": ">=4.0" + } + } + } +} diff --git a/news-app/package.json b/news-app/package.json new file mode 100644 index 0000000..4e6fea7 --- /dev/null +++ b/news-app/package.json @@ -0,0 +1,27 @@ +{ + "name": "news-app", + "private": true, + "version": "0.0.0", + "type": "module", + "scripts": { + "dev": "node server.js & vite", + "server": "node server.js", + "build": "vite build", + "preview": "vite preview" + }, + "devDependencies": { + "@tailwindcss/vite": "^4.1.18", + "autoprefixer": "^10.4.23", + "postcss": "^8.5.6", + "tailwindcss": "^4.1.18", + "vite": "^7.2.4" + }, + "dependencies": { + "better-sqlite3": "^12.6.2", + "cors": "^2.8.6", + "dotenv": "^17.2.3", + "express": "^5.2.1", + "openai": "^6.16.0", + "rss-parser": "^3.13.0" + } +} diff --git a/news-app/public/vite.svg b/news-app/public/vite.svg new file mode 100644 index 0000000..e7b8dfb --- /dev/null +++ b/news-app/public/vite.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/news-app/server.js b/news-app/server.js new file mode 100644 index 0000000..f809109 --- /dev/null +++ b/news-app/server.js @@ -0,0 +1,324 @@ +import 'dotenv/config' +import express from 'express' +import cors from 'cors' +import Parser from 'rss-parser' +import OpenAI from 'openai' +import Database from 'better-sqlite3' + +const app = express() +const openai = new OpenAI({ apiKey: process.env.OPENAI_API_KEY }) +const parser = new Parser() +const PORT = 5555 + +// Initialize SQLite database for caching +const db = new Database('cache.db') +db.exec(` + CREATE TABLE IF NOT EXISTS grouped_news_cache ( + id INTEGER PRIMARY KEY, + data TEXT NOT NULL, + created_at INTEGER NOT NULL + ) +`) + +const CACHE_DURATION_MS = 3 * 60 * 60 * 1000 // 3 hours + +function getCachedGroupedNews() { + const row = db.prepare('SELECT data, created_at FROM grouped_news_cache WHERE id = 1').get() + if (!row) return null + + const age = Date.now() - row.created_at + if (age > CACHE_DURATION_MS) return null + + return { data: JSON.parse(row.data), age } +} + +function setCachedGroupedNews(data) { + const stmt = db.prepare('INSERT OR REPLACE INTO grouped_news_cache (id, data, created_at) VALUES (1, ?, ?)') + stmt.run(JSON.stringify(data), Date.now()) +} + +function clearCache() { + db.prepare('DELETE FROM grouped_news_cache').run() +} + +// Source names to filter out from AI summaries +const SOURCE_NAMES = [ + 'ABC News', 'ABC', 'NPR', 'CNN', 'Reuters', 'NBC News', 'NBC', + 'CBS News', 'CBS', 'NY Times', 'New York Times', 'NYT', 'AP News', + 'Associated Press', 'AP', 'BBC', 'Guardian', 'The Guardian' +] + +function replaceSourceNames(text) { + if (!text) return text + let result = text + // Sort by length descending to replace longer names first (e.g., "New York Times" before "NY") + const sortedNames = [...SOURCE_NAMES].sort((a, b) => b.length - a.length) + for (const name of sortedNames) { + // Use word boundaries to only match whole words, not parts of other words + const regex = new RegExp(`\\b${name}\\b`, 'gi') + result = result.replace(regex, '[news]') + } + return result +} + +function sanitizeGroups(groups) { + return groups.map(group => { + const newTitle = replaceSourceNames(group.title) + const newSummary = replaceSourceNames(group.summary) + if (newTitle !== group.title || newSummary !== group.summary) { + console.log(`Replaced source names in group: "${group.title}"`) + } + return { + ...group, + title: newTitle, + summary: newSummary, + } + }) +} + +app.use(cors()) + +const RSS_FEEDS = { + abc: 'https://abcnews.go.com/abcnews/topstories', + npr: 'https://feeds.npr.org/1001/rss.xml', + cnn: 'http://rss.cnn.com/rss/cnn_topstories.rss', + nbc: 'https://feeds.nbcnews.com/nbcnews/public/news', + cbs: 'https://www.cbsnews.com/latest/rss/main', + nytimes: 'https://rss.nytimes.com/services/xml/rss/nyt/HomePage.xml', +} + +app.get('/api/news', async (req, res) => { + try { + const results = await Promise.allSettled( + Object.entries(RSS_FEEDS).map(async ([source, url]) => { + const feed = await parser.parseURL(url) + return { + source, + title: feed.title, + items: feed.items.map((item) => ({ + title: item.title, + link: item.link, + pubDate: item.pubDate, + content: item.contentSnippet || item.content || '', + source, + image: extractImage(item), + })), + } + }) + ) + + const feeds = results + .filter((r) => r.status === 'fulfilled') + .map((r) => r.value) + + const errors = results + .filter((r) => r.status === 'rejected') + .map((r, i) => ({ source: Object.keys(RSS_FEEDS)[i], error: r.reason.message })) + + res.json({ feeds, errors }) + } catch (error) { + res.status(500).json({ error: error.message }) + } +}) + +// Endpoint to clear the cache +app.post('/api/clear-cache', (req, res) => { + clearCache() + console.log('Cache cleared by user') + res.json({ success: true, message: 'Cache cleared' }) +}) + +app.get('/api/grouped-news', async (req, res) => { + try { + // Check if user wants to force refresh + const forceRefresh = req.query.refresh === 'true' + + if (forceRefresh) { + clearCache() + console.log('Force refresh requested - cache cleared') + } + + // Check cache first + const cached = getCachedGroupedNews() + if (cached) { + const remainingMs = CACHE_DURATION_MS - cached.age + const remainingMins = Math.round(remainingMs / 60000) + console.log(`Serving cached grouped news (${remainingMins} minutes until refresh)`) + return res.json({ groups: cached.data, cached: true, cacheExpiresIn: remainingMins }) + } + + console.log('Cache miss - fetching RSS feeds...') + + // Fetch all news first + const results = await Promise.allSettled( + Object.entries(RSS_FEEDS).map(async ([source, url]) => { + console.log(` Fetching ${source}...`) + try { + const feed = await parser.parseURL(url) + console.log(` ✓ ${source}: ${feed.items.length} articles`) + return { + source, + items: feed.items.map((item) => ({ + title: item.title, + link: item.link, + pubDate: item.pubDate, + content: item.contentSnippet || item.content || '', + source, + image: extractImage(item), + })), + } + } catch (err) { + console.log(` ✗ ${source}: ${err.message}`) + throw err + } + }) + ) + + const feedResults = results + .filter((r) => r.status === 'fulfilled') + .map((r) => r.value) + + // Ensure at least 5 articles from each source, then fill rest by date + const MIN_PER_SOURCE = 5 + const TOTAL_LIMIT = 50 + + let selectedArticles = [] + const usedIds = new Set() + + // First pass: take up to MIN_PER_SOURCE from each source (sorted by date) + for (const feed of feedResults) { + const sorted = [...feed.items].sort((a, b) => new Date(b.pubDate) - new Date(a.pubDate)) + const toTake = sorted.slice(0, MIN_PER_SOURCE) + for (const article of toTake) { + const id = article.link + if (!usedIds.has(id)) { + usedIds.add(id) + selectedArticles.push(article) + } + } + } + + // Second pass: fill remaining slots with newest articles across all sources + const allRemaining = feedResults + .flatMap((f) => f.items) + .filter((a) => !usedIds.has(a.link)) + .sort((a, b) => new Date(b.pubDate) - new Date(a.pubDate)) + + const remaining = TOTAL_LIMIT - selectedArticles.length + selectedArticles.push(...allRemaining.slice(0, remaining)) + + // Final sort by date + const allArticles = selectedArticles.sort((a, b) => new Date(b.pubDate) - new Date(a.pubDate)) + + console.log(`Selected ${allArticles.length} articles (min ${MIN_PER_SOURCE}/source, then by date)`) + + if (allArticles.length === 0) { + return res.json({ groups: [] }) + } + + // Send to OpenAI for grouping + const articlesForAI = allArticles.map((a, i) => ({ + id: i, + title: a.title, + content: a.content?.slice(0, 200) || '', + source: a.source, + })) + + console.log(`Sending ${articlesForAI.length} articles to OpenAI gpt-5-mini...`) + const completion = await openai.chat.completions.create({ + model: 'gpt-5-mini', + messages: [ + { + role: 'system', + content: `You are a news analyst. Group articles that cover THE SAME SPECIFIC NEWS STORY together. + +IMPORTANT RULES: +- Each group must contain articles about ONE specific news event or story +- Do NOT combine unrelated topics into a single group +- Do NOT create broad category groups (e.g., "Various Political News") +- Articles about different events should be in SEPARATE groups, even if they share a category +- It's better to have more specific groups than fewer broad ones +- If an article doesn't match any group, put it in its own single-article group + +WRITING RULES: +- Write ORIGINAL titles - do NOT copy or closely paraphrase headlines from the source articles +- Write ORIGINAL summaries in your own words - do NOT copy sentences from the articles +- Synthesize information from multiple sources into a fresh, unique narrative +- Use different phrasing and sentence structure than the originals +- Never mention the news source names (ABC, CNN, NPR, etc.) in titles or summaries + +Return JSON in this exact format: +{ + "groups": [ + { + "title": "Your original headline for this story (max 80 chars)", + "summary": "Your original summary synthesizing the story in your own words (max 500 chars)", + "articleIds": [0, 1, 2], + "category": "politics|business|technology|sports|entertainment|health|science|world|other" + } + ] +} +Only return valid JSON.` + }, + { + role: 'user', + content: JSON.stringify(articlesForAI) + } + ], + }) + + const aiResponse = JSON.parse(completion.choices[0].message.content) + console.log(`✓ OpenAI returned ${aiResponse.groups.length} groups`) + + // Enrich groups with source articles and images + const enrichedGroups = aiResponse.groups.map((group) => { + const groupArticles = group.articleIds + .map((id) => allArticles[id]) + .filter(Boolean) + + const images = groupArticles + .map((a) => a.image) + .filter(Boolean) + + const sources = [...new Set(groupArticles.map((a) => a.source))] + const links = groupArticles.map((a) => ({ title: a.title, link: a.link, source: a.source })) + + return { + title: group.title, + summary: group.summary, + category: group.category, + image: images[0] || null, + sources, + articles: links, + articleCount: groupArticles.length, + } + }) + + // Replace any source name mentions with [news] + const sanitizedGroups = sanitizeGroups(enrichedGroups) + + // Cache the results + setCachedGroupedNews(sanitizedGroups) + console.log(`Cached ${sanitizedGroups.length} grouped news for 3 hours`) + + res.json({ groups: sanitizedGroups, cached: false }) + } catch (error) { + console.error('Grouped news error:', error) + res.status(500).json({ error: error.message }) + } +}) + +function extractImage(item) { + if (item.enclosure?.url) return item.enclosure.url + if (item['media:content']?.$.url) return item['media:content'].$.url + if (item['media:thumbnail']?.$.url) return item['media:thumbnail'].$.url + + const contentMatch = (item.content || '').match(/]+src="([^"]+)"/) + if (contentMatch) return contentMatch[1] + + return null +} + +app.listen(PORT, () => { + console.log(`API server running on http://localhost:${PORT}`) +}) diff --git a/news-app/src/counter.js b/news-app/src/counter.js new file mode 100644 index 0000000..881e2d7 --- /dev/null +++ b/news-app/src/counter.js @@ -0,0 +1,9 @@ +export function setupCounter(element) { + let counter = 0 + const setCounter = (count) => { + counter = count + element.innerHTML = `count is ${counter}` + } + element.addEventListener('click', () => setCounter(counter + 1)) + setCounter(0) +} diff --git a/news-app/src/javascript.svg b/news-app/src/javascript.svg new file mode 100644 index 0000000..f9abb2b --- /dev/null +++ b/news-app/src/javascript.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/news-app/src/main.js b/news-app/src/main.js new file mode 100644 index 0000000..9acdec4 --- /dev/null +++ b/news-app/src/main.js @@ -0,0 +1,539 @@ +import './style.css' + +const API_BASE = import.meta.env.BASE_URL + 'api' +const app = document.querySelector('#app') + +const state = { + articles: [], + groups: [], + loading: true, + error: null, + filter: 'all', + viewMode: 'regular', // 'regular' or 'ai' + carMode: false, + carModeIndex: 0, + carModeInterval: null, +} + +function formatDate(dateString) { + const date = new Date(dateString) + const now = new Date() + const diff = now - date + const hours = Math.floor(diff / (1000 * 60 * 60)) + const minutes = Math.floor(diff / (1000 * 60)) + + if (minutes < 60) return minutes + 'm ago' + if (hours < 24) return hours + 'h ago' + return date.toLocaleDateString('en-US', { month: 'short', day: 'numeric' }) +} + +function truncate(text, maxLength = 150) { + if (!text || text.length <= maxLength) return text || '' + return text.slice(0, maxLength).trim() + '...' +} + +const SOURCE_CONFIG = { + abc: { name: 'ABC News', color: 'bg-blue-100 text-blue-800' }, + npr: { name: 'NPR', color: 'bg-indigo-100 text-indigo-800' }, + cnn: { name: 'CNN', color: 'bg-orange-100 text-orange-800' }, + nbc: { name: 'NBC News', color: 'bg-purple-100 text-purple-800' }, + cbs: { name: 'CBS News', color: 'bg-emerald-100 text-emerald-800' }, + nytimes: { name: 'NY Times', color: 'bg-slate-100 text-slate-800' }, +} + +function getSourceColor(source) { + return SOURCE_CONFIG[source]?.color || 'bg-gray-100 text-gray-800' +} + +function getSourceName(source) { + return SOURCE_CONFIG[source]?.name || source +} + +const CATEGORY_COLORS = { + politics: 'bg-red-100 text-red-800', + business: 'bg-green-100 text-green-800', + technology: 'bg-blue-100 text-blue-800', + sports: 'bg-orange-100 text-orange-800', + entertainment: 'bg-pink-100 text-pink-800', + health: 'bg-teal-100 text-teal-800', + science: 'bg-purple-100 text-purple-800', + world: 'bg-indigo-100 text-indigo-800', + other: 'bg-gray-100 text-gray-800', +} + +function getCategoryColor(category) { + return CATEGORY_COLORS[category] || CATEGORY_COLORS.other +} + +function renderGroupCard(group) { + const imageHtml = group.image + ? `
` + : '' + + const sourceBadges = group.sources + .slice(0, 3) + .map(s => `${getSourceName(s)}`) + .join('') + + const moreCount = group.sources.length > 3 ? `+${group.sources.length - 3}` : '' + + return `
+ ${imageHtml} +
+
+ + ${group.category} + + ${group.articleCount} articles + AI Summary +
+

+ ${group.title} +

+

+ ${group.summary} +

+
+ ${sourceBadges}${moreCount} +
+
+ View source articles + +
+
+
` +} + +function renderArticle(article) { + const imageHtml = article.image + ? `
` + : '' + + return `` +} + +function renderLoading() { + const message = state.viewMode === 'ai' + ? 'AI is analyzing and grouping news...' + : 'Loading latest news...' + return `
+
+

${message}

+
` +} + +function renderError(error) { + return `
+
+ + +
+

Failed to load news

+

${error}

+ +
` +} + +function renderEmpty() { + return `
+
+ + +
+

No articles found

+

Try selecting a different source filter.

+
` +} + +function renderCarModeCard(group, index, total) { + const sourceBadges = group.sources + .slice(0, 4) + .map(s => `${getSourceName(s)}`) + .join('') + + const moreCount = group.sources.length > 4 ? `+${group.sources.length - 4} more` : '' + + return ` +
+ ${group.image ? ` +
+ +
+ ` : ''} +
+
+ + ${group.category} + + ${group.articleCount} articles + AI Summary +
+

+ ${group.title} +

+

+ ${group.summary} +

+
+ ${sourceBadges}${moreCount} +
+
+ +
+
+
+
+ +
+ ${Array.from({ length: total }, (_, i) => ` +
+ `).join('')} +
+ ` +} + +function renderCarMode() { + if (state.groups.length === 0) { + return ` +
+
+
+
+
+
+

Loading AI grouped news...

+
+ +
+ ` + } + + const currentGroup = state.groups[state.carModeIndex] + + return ` +
+
+
+
+ + + + + + + + + +
+ ${renderCarModeCard(currentGroup, state.carModeIndex, state.groups.length)} +
+ + +
+ + + + + Car Mode +
+
+ ` +} + +function render() { + // If car mode is active, render car mode overlay + if (state.carMode) { + app.innerHTML = renderCarMode() + return + } + + const filteredArticles = state.filter === 'all' + ? state.articles + : state.articles.filter(a => a.source === state.filter) + + const spinClass = state.loading ? 'animate-spin' : '' + const sources = [...new Set(state.articles.map(a => a.source))] + + let content = '' + if (state.loading) { + content = renderLoading() + } else if (state.error) { + content = renderError(state.error) + } else if (state.viewMode === 'ai') { + if (state.groups.length === 0) { + content = renderEmpty() + } else { + content = state.groups.map(renderGroupCard).join('') + } + } else if (filteredArticles.length === 0) { + content = renderEmpty() + } else { + content = filteredArticles.map(renderArticle).join('') + } + + const regularBtnClass = state.viewMode === 'regular' ? 'bg-gray-900 text-white' : 'bg-gray-100 text-gray-700 hover:bg-gray-200' + const aiBtnClass = state.viewMode === 'ai' ? 'bg-blue-600 text-white' : 'bg-blue-100 text-blue-700 hover:bg-blue-200' + + const filterButtons = state.viewMode === 'regular' ? ` + + ${sources.map(source => ``).join('')} + ` : '' + + app.innerHTML = `
+
+
+
+
+

News Feed

+

${state.viewMode === 'ai' ? 'AI-grouped summaries from multiple sources' : 'Latest headlines from multiple sources'}

+
+
+
+ + +
+ ${filterButtons} + ${state.viewMode === 'ai' ? `` : ''} + + +
+
+
+ ${content} +
+
` +} + +async function fetchNews() { + state.loading = true + state.error = null + render() + + try { + const response = await fetch(`${API_BASE}/news`) + if (!response.ok) throw new Error('Failed to fetch news') + + const data = await response.json() + + const allArticles = data.feeds + .flatMap(feed => feed.items) + .sort((a, b) => new Date(b.pubDate) - new Date(a.pubDate)) + + state.articles = allArticles + state.loading = false + + if (data.errors && data.errors.length > 0) { + console.warn('Some feeds failed:', data.errors) + } + } catch (error) { + state.error = error.message + state.loading = false + } + + render() +} + +async function fetchGroupedNews() { + state.loading = true + state.error = null + render() + + try { + const response = await fetch(`${API_BASE}/grouped-news`) + if (!response.ok) throw new Error('Failed to fetch grouped news') + + const data = await response.json() + state.groups = data.groups + state.loading = false + } catch (error) { + state.error = error.message + state.loading = false + } + + render() +} + +window.setFilter = function(filter) { + state.filter = filter + render() +} + +window.setViewMode = function(mode) { + state.viewMode = mode + if (mode === 'ai' && state.groups.length === 0) { + fetchGroupedNews() + } else { + render() + } +} + +window.refresh = function() { + if (state.viewMode === 'ai') { + fetchGroupedNews() + } else { + fetchNews() + } +} + +window.clearCacheAndRefresh = async function() { + state.loading = true + state.error = null + render() + + try { + const response = await fetch(`${API_BASE}/grouped-news?refresh=true`) + if (!response.ok) throw new Error('Failed to fetch grouped news') + + const data = await response.json() + state.groups = data.groups + state.loading = false + } catch (error) { + state.error = error.message + state.loading = false + } + + render() +} + +window.fetchNews = fetchNews +window.fetchGroupedNews = fetchGroupedNews + +// Car Mode Functions +window.enterCarMode = async function() { + state.carMode = true + state.carModeIndex = 0 + render() + + // Fetch AI grouped news if not already loaded + if (state.groups.length === 0) { + try { + const response = await fetch(`${API_BASE}/grouped-news`) + if (!response.ok) throw new Error('Failed to fetch grouped news') + const data = await response.json() + state.groups = data.groups + render() + } catch (error) { + console.error('Failed to load grouped news for car mode:', error) + } + } + + // Start auto-cycling every 5 seconds + startCarModeCycle() +} + +window.exitCarMode = function() { + state.carMode = false + stopCarModeCycle() + render() +} + +window.carModeNext = function() { + if (state.groups.length === 0) return + state.carModeIndex = (state.carModeIndex + 1) % state.groups.length + // Reset the cycle timer when manually navigating + stopCarModeCycle() + render() + startCarModeCycle() +} + +window.carModePrev = function() { + if (state.groups.length === 0) return + state.carModeIndex = (state.carModeIndex - 1 + state.groups.length) % state.groups.length + // Reset the cycle timer when manually navigating + stopCarModeCycle() + render() + startCarModeCycle() +} + +function startCarModeCycle() { + stopCarModeCycle() // Clear any existing interval + state.carModeInterval = setInterval(() => { + if (state.groups.length > 0) { + state.carModeIndex = (state.carModeIndex + 1) % state.groups.length + render() + } + }, 5000) // 5 seconds per card +} + +function stopCarModeCycle() { + if (state.carModeInterval) { + clearInterval(state.carModeInterval) + state.carModeInterval = null + } +} + +// Keyboard support for car mode +document.addEventListener('keydown', (e) => { + if (!state.carMode) return + + switch (e.key) { + case 'Escape': + window.exitCarMode() + break + case 'ArrowRight': + case ' ': + window.carModeNext() + break + case 'ArrowLeft': + window.carModePrev() + break + } +}) + +fetchNews() + +setInterval(() => { + if (state.viewMode === 'ai') { + fetchGroupedNews() + } else { + fetchNews() + } +}, 5 * 60 * 1000) diff --git a/news-app/src/style.css b/news-app/src/style.css new file mode 100644 index 0000000..fcf4460 --- /dev/null +++ b/news-app/src/style.css @@ -0,0 +1,118 @@ +@import 'tailwindcss'; + +/* Car Mode Animated Background */ +.car-mode-bg { + background: linear-gradient(135deg, #1a1a2e 0%, #16213e 50%, #0f3460 100%); + position: relative; + overflow: hidden; +} + +.car-mode-bg::before, +.car-mode-bg::after { + content: ''; + position: absolute; + border-radius: 50%; + filter: blur(80px); + opacity: 0.4; + animation: float 20s ease-in-out infinite; +} + +.car-mode-bg::before { + width: 600px; + height: 600px; + background: linear-gradient(135deg, #667eea 0%, #764ba2 100%); + top: -200px; + left: -200px; + animation-delay: 0s; +} + +.car-mode-bg::after { + width: 500px; + height: 500px; + background: linear-gradient(135deg, #f093fb 0%, #f5576c 100%); + bottom: -150px; + right: -150px; + animation-delay: -10s; +} + +.car-mode-blur-1, +.car-mode-blur-2, +.car-mode-blur-3 { + position: absolute; + border-radius: 50%; + filter: blur(100px); + opacity: 0.3; + animation: float 25s ease-in-out infinite; +} + +.car-mode-blur-1 { + width: 400px; + height: 400px; + background: linear-gradient(135deg, #4facfe 0%, #00f2fe 100%); + top: 50%; + left: 20%; + animation-delay: -5s; +} + +.car-mode-blur-2 { + width: 350px; + height: 350px; + background: linear-gradient(135deg, #43e97b 0%, #38f9d7 100%); + top: 30%; + right: 10%; + animation-delay: -15s; +} + +.car-mode-blur-3 { + width: 300px; + height: 300px; + background: linear-gradient(135deg, #fa709a 0%, #fee140 100%); + bottom: 20%; + left: 50%; + animation-delay: -8s; +} + +@keyframes float { + 0%, 100% { + transform: translate(0, 0) scale(1); + } + 25% { + transform: translate(50px, -30px) scale(1.1); + } + 50% { + transform: translate(-20px, 40px) scale(0.95); + } + 75% { + transform: translate(-40px, -20px) scale(1.05); + } +} + +/* Car Mode Card Transitions */ +.car-mode-card { + animation: cardFadeIn 0.8s ease-out; +} + +@keyframes cardFadeIn { + from { + opacity: 0; + transform: translateY(30px) scale(0.95); + } + to { + opacity: 1; + transform: translateY(0) scale(1); + } +} + +/* Progress bar animation */ +.car-mode-progress { + animation: progressFill 5s linear; +} + +@keyframes progressFill { + from { + width: 0%; + } + to { + width: 100%; + } +} diff --git a/news-app/vite.config.js b/news-app/vite.config.js new file mode 100644 index 0000000..028e3e4 --- /dev/null +++ b/news-app/vite.config.js @@ -0,0 +1,15 @@ +import { defineConfig } from 'vite' +import tailwindcss from '@tailwindcss/vite' + +export default defineConfig({ + base: '/carnews/', + plugins: [tailwindcss()], + server: { + proxy: { + '/api': { + target: 'http://localhost:5555', + changeOrigin: true, + }, + }, + }, +})